Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 300

1.
an image of a chemical structure CID 6626

4,4'-Sulfonyldiphenol; Bisphenol S; 80-09-1 ...

MW:
250.270
g/mol
MF:
C12H10O4S
IUPAC name:
4-(4-hydroxyphenyl)sulfonylphenol
Create Date:
2005-03-26
2.
an image of a chemical structure CID 154549230

MW:
251.280
g/mol
MF:
C12H11O4S+
IUPAC name:
[4-(4-hydroxyphenyl)sulfonylphenyl]oxidanium
Create Date:
2020-08-14
3.
an image of a chemical structure CID 138396058

4,4'-Sulfonyldi(~2~H)phenol; DTXSID80892708

MW:
252.280
g/mol
MF:
C12H10O4S
IUPAC name:
1-deuteriooxy-4-(4-deuteriooxyphenyl)sulfonylbenzene
Create Date:
2019-06-20
4.
an image of a chemical structure CID 69776990

SCHEMBL6425932

MW:
268.290
g/mol
MF:
C12H12O5S
IUPAC name:
4-(4-hydroxyphenyl)sulfonylphenol;hydrate
Create Date:
2012-12-01
5.
an image of a chemical structure CID 57489100

MW:
249.260
g/mol
MF:
C12H9O4S-
IUPAC name:
4-(4-hydroxyphenyl)sulfonylphenolate
Create Date:
2012-08-08
6.
an image of a chemical structure CID 146762127

MW:
266.270
g/mol
MF:
C12H10O5S
IUPAC name:
4-(4-hydroperoxyphenyl)sulfonylphenol
Create Date:
2020-08-12
7.
an image of a chemical structure CID 68122522

SCHEMBL7937377

MW:
289.370
g/mol
MF:
C12H10KO4S
Create Date:
2012-11-30
8.
an image of a chemical structure CID 67322119

SCHEMBL2221630

MW:
290.300
g/mol
MF:
C15H14O4S
IUPAC name:
cyclopropene;4-(4-hydroxyphenyl)sulfonylphenol
Create Date:
2012-11-30
9.
an image of a chemical structure CID 23682444

Phenol, 4,4'-sulfonylbis-, monosodium salt; Phenol, 4,4'-sulfonylbis-, sodium salt (1:1); 20210-83-7 ...

MW:
272.250
g/mol
MF:
C12H9NaO4S
IUPAC name:
sodium;4-(4-hydroxyphenyl)sulfonylphenolate
Create Date:
2008-02-05
10.
an image of a chemical structure CID 343804

4-(benzenesulfonyl)phenol; 7402-69-9; 4-(Phenylsulfonyl)phenol ...

MW:
234.270
g/mol
MF:
C12H10O3S
IUPAC name:
4-(benzenesulfonyl)phenol
Create Date:
2005-03-26
11.
an image of a chemical structure CID 148119005

MW:
235.280
g/mol
MF:
C12H11O3S+
IUPAC name:
[(4-hydroxyphenyl)-oxo-phenyl-lambda6-sulfanylidene]oxidaniu...
Create Date:
2020-08-12
12.
an image of a chemical structure CID 141792062

MW:
280.340
g/mol
MF:
C14H16O4S
IUPAC name:
ethane;4-(4-hydroxyphenyl)sulfonylphenol
Create Date:
2019-12-06
13.
an image of a chemical structure CID 131710859

disodium bis-(4-hydroxyphenyl)-sulfone

MW:
296.250
g/mol
MF:
C12H10Na2O4S
IUPAC name:
4-(4-hydroxyphenyl)sulfonylphenol;sodiosodium
Create Date:
2017-11-15
14.
an image of a chemical structure CID 117759977

SCHEMBL16319030; S(=O)(=O)(C1=CC=C(C=C1)O)C1(CC=CC=C1)O

MW:
252.290
g/mol
MF:
C12H12O4S
IUPAC name:
4-(1-hydroxycyclohexa-2,4-dien-1-yl)sulfonylphenol
Create Date:
2016-02-23
15.
an image of a chemical structure CID 87177636

SCHEMBL931146; [Ti]Oc1ccc(cc1)S(=O)(=O)c1ccccc1

MW:
282.140
g/mol
MF:
C12H10O3STi
IUPAC name:
4-(benzenesulfonyl)phenol;titanium
Create Date:
2015-02-12
16.
an image of a chemical structure CID 70636806

SCHEMBL11699158

MW:
296.250
g/mol
MF:
C12H10Na2O4S
Create Date:
2012-12-01
17.
an image of a chemical structure CID 70407026

SCHEMBL10624752

MW:
323.200
g/mol
MF:
C12H12Cl2O4S
IUPAC name:
4-(4-hydroxyphenyl)sulfonylphenol;dihydrochloride
Create Date:
2012-12-01
18.
an image of a chemical structure CID 70233075

SCHEMBL7938040

MW:
328.470
g/mol
MF:
C12H10K2O4S
Create Date:
2012-12-01
19.
an image of a chemical structure CID 68311567

SCHEMBL12531363

MW:
252.290
g/mol
MF:
C12H12O4S
IUPAC name:
4-(4-hydroxycyclohexa-1,3-dien-1-yl)sulfonylphenol
Create Date:
2012-11-30
20.
an image of a chemical structure CID 66847526

SCHEMBL931874; [Zn]Oc1ccc(cc1)S(=O)(=O)c1ccccc1

MW:
299.700
g/mol
MF:
C12H10O3SZn
IUPAC name:
4-(benzenesulfonyl)phenol;zinc
Create Date:
2012-11-30
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center