Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 70

1.
an image of a chemical structure CID 104730

7440-48-4; Co; Cobalt ...

MW:
58.933
g/mol
MF:
Co
IUPAC name:
cobalt
Create Date:
2004-09-16
2.
an image of a chemical structure CID 178158

Cobalt-61; Cobalt Co-61; UNII-3O95285REP ...

MW:
60.932
g/mol
MF:
Co
IUPAC name:
cobalt-61
Create Date:
2005-08-09
3.
an image of a chemical structure CID 177473

Cobalt-62; Cobalt, isotope of mass 62; 14809-62-2 ...

MW:
61.934
g/mol
MF:
Co
IUPAC name:
cobalt-62
Create Date:
2005-08-09
4.
an image of a chemical structure CID 166998

Cobalt-56; Cobalt Co-56; UNII-ZL81HD0T6M ...

MW:
55.940
g/mol
MF:
Co
IUPAC name:
cobalt-56
Create Date:
2005-08-08
5.
an image of a chemical structure CID 166968

Cobalt-55; Cobalt Co-55; UNII-10SW5U3C7A ...

MW:
54.942
g/mol
MF:
Co
IUPAC name:
cobalt-55
Create Date:
2005-08-08
6.
an image of a chemical structure CID 104851

Cobalt-57; cobalt co-57; 13981-50-5 ...

MW:
56.936
g/mol
MF:
Co
IUPAC name:
cobalt-57
Create Date:
2005-08-08
7.
an image of a chemical structure CID 104844

Cobalt-58; Cobalt Co-58; UNII-Z76Y2OT3HD ...

MW:
57.936
g/mol
MF:
Co
IUPAC name:
cobalt-58
Create Date:
2005-08-08
8.
an image of a chemical structure CID 61492

Cobalt-60; Cobalt Co-60; COBALT 60 ...

MW:
59.934
g/mol
MF:
Co
IUPAC name:
cobalt-60
Create Date:
2005-08-08
9.
an image of a chemical structure CID 156022700

CHEBI:176616

MW:
58.933
g/mol
MF:
Co+3
IUPAC name:
cobalt-59(3+)
Create Date:
2021-08-01
10.
an image of a chemical structure CID 154487522

[Co]([2H])[2H]

MW:
62.961
g/mol
MF:
CoH2
IUPAC name:
dideuteriocobalt
Create Date:
2020-08-14
11.
an image of a chemical structure CID 154333917

[Co][Co][Co][Co][Co][Co][Co][Co]

MW:
471.466
g/mol
MF:
Co8
IUPAC name:
cobalt
Create Date:
2020-08-14
12.
an image of a chemical structure CID 154090430

[Co+][Co++]

MW:
117.866
g/mol
MF:
Co2+2
IUPAC name:
cobalt;cobalt(2+)
Create Date:
2020-08-14
13.
an image of a chemical structure CID 153488702

MW:
530.399
g/mol
MF:
Co9
IUPAC name:
cobalt
Create Date:
2020-08-13
14.
an image of a chemical structure CID 153488701

MW:
2357.328
g/mol
MF:
Co40
IUPAC name:
cobalt
Create Date:
2020-08-13
15.
an image of a chemical structure CID 153488700

MW:
766.131
g/mol
MF:
Co13
IUPAC name:
cobalt
Create Date:
2020-08-13
16.
an image of a chemical structure CID 153488699

MW:
1355.464
g/mol
MF:
Co23
IUPAC name:
cobalt
Create Date:
2020-08-13
17.
an image of a chemical structure CID 153488697

MW:
3594.925
g/mol
MF:
Co61
IUPAC name:
cobalt
Create Date:
2020-08-13
18.
an image of a chemical structure CID 153488695

MW:
3005.593
g/mol
MF:
Co51
IUPAC name:
cobalt
Create Date:
2020-08-13
19.
an image of a chemical structure CID 153488694

MW:
707.198
g/mol
MF:
Co12
IUPAC name:
cobalt
Create Date:
2020-08-13
20.
an image of a chemical structure CID 153488693

MW:
3477.058
g/mol
MF:
Co59
IUPAC name:
cobalt
Create Date:
2020-08-13
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center