Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 60

1.
an image of a chemical structure CID 129716794

(35s)hypotaurine

MW:
112.050
g/mol
MF:
C2H7NO2S
IUPAC name:
2-aminoethane(35S)sulfinic acid
Create Date:
2017-09-13
2.
an image of a chemical structure CID 107812

hypotaurine; 2-Aminoethanesulfinic acid; 300-84-5 ...

MW:
109.150
g/mol
MF:
C2H7NO2S
IUPAC name:
2-aminoethanesulfinic acid
Create Date:
2004-09-16
3.
an image of a chemical structure CID 155683165

MW:
127.160
g/mol
MF:
C2H7NO3S
IUPAC name:
2-amino-2,2-dideuterioethanesulfonic acid
Create Date:
2021-02-21
4.
an image of a chemical structure CID 155683161

MW:
126.160
g/mol
MF:
C2H7NO3S
IUPAC name:
2-(deuterioamino)ethanesulfonic acid
Create Date:
2021-02-21
5.
an image of a chemical structure CID 154082711

S(=O)(=O)(O)CC[NH-]

MW:
124.140
g/mol
MF:
C2H6NO3S-
IUPAC name:
2-sulfoethylazanide
Create Date:
2020-08-14
6.
an image of a chemical structure CID 131988358

SCHEMBL19438591

MW:
127.170
g/mol
MF:
C2H9NO3S
IUPAC name:
2-aminoethanesulfinic acid;hydrate
Create Date:
2018-01-29
7.
an image of a chemical structure CID 129846759

d4-taurine; N(C(CS(=O)(=O)O)([2H])[2H])([2H])[2H]

MW:
129.170
g/mol
MF:
C2H7NO3S
IUPAC name:
2,2-dideuterio-2-(dideuterioamino)ethanesulfonic acid
Create Date:
2017-09-13
8.
an image of a chemical structure CID 129660521

(35s)taurine; NCC[35S](=O)(=O)O

MW:
128.050
g/mol
MF:
C2H7NO3S
IUPAC name:
2-aminoethane(35S)sulfonic acid
Create Date:
2017-09-13
9.
an image of a chemical structure CID 54479513

MW:
127.140
g/mol
MF:
C2H7NO3S
IUPAC name:
2-amino(214C)ethanesulfonic acid
Create Date:
2011-12-04
10.
an image of a chemical structure CID 49849888

Taurine-d4; 342611-14-7; 2-AMINOETHANE-D4-SULFONIC ACID ...

MW:
129.170
g/mol
MF:
C2H7NO3S
IUPAC name:
2-amino-1,1,2,2-tetradeuterioethanesulfonic acid
Create Date:
2011-02-01
11.
an image of a chemical structure CID 49849887

2-Amino(~13~C_2_)ethane-1-sulfonic acid; 2-amino(1,2-13C2)ethanesulfonic acid; 70155-54-3 ...

MW:
127.140
g/mol
MF:
C2H7NO3S
IUPAC name:
2-amino(1,2-13C2)ethanesulfonic acid
Create Date:
2011-02-01
12.
an image of a chemical structure CID 12359084

Taurine-15N; 127041-63-8; 2-(15N)azanylethanesulfonic acid ...

MW:
126.140
g/mol
MF:
C2H7NO3S
IUPAC name:
2-(15N)azanylethanesulfonic acid
Create Date:
2007-02-07
13.
an image of a chemical structure CID 6858023

Thiotaurine; 2937-54-4; 2-Aminoethanethiosulfonic acid ...

MW:
141.220
g/mol
MF:
C2H7NO2S2
IUPAC name:
2-hydroxysulfonothioylethanamine
Create Date:
2006-07-03
14.
an image of a chemical structure CID 1123

taurine; 2-aminoethanesulfonic acid; 107-35-7 ...

MW:
125.150
g/mol
MF:
C2H7NO3S
IUPAC name:
2-aminoethanesulfonic acid
Create Date:
2004-09-16
15.
an image of a chemical structure CID 151549997

MW:
281.400
g/mol
MF:
C2H6GdNO3S-
IUPAC name:
gadolinium;2-sulfoethylazanide
Create Date:
2020-08-13
16.
an image of a chemical structure CID 150282311

MW:
321.110
g/mol
MF:
C2H6AuNO3S
IUPAC name:
gold(1+);2-sulfoethylazanide
Create Date:
2020-08-12
17.
an image of a chemical structure CID 148668782

MW:
125.190
g/mol
MF:
C3H11NO2S+2
IUPAC name:
3-oxoniosulfinylpropylazanium
Create Date:
2020-08-12
18.
an image of a chemical structure CID 131877684

MW:
164.210
g/mol
MF:
C2H7NNaO2S2
Create Date:
2017-12-18
19.
an image of a chemical structure CID 129717025

hypotaurine hydrochloride

MW:
145.610
g/mol
MF:
C2H8ClNO2S
IUPAC name:
2-aminoethanesulfinic acid;hydrochloride
Create Date:
2017-09-13
20.
an image of a chemical structure CID 87210711

SCHEMBL1191927; 2-(chloroamino)ethanesulfinic acid

MW:
143.590
g/mol
MF:
C2H6ClNO2S
IUPAC name:
2-(chloroamino)ethanesulfinic acid
Create Date:
2015-02-12
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center