Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 533

1.
an image of a chemical structure CID 129853636

Paracetamol-d3

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
2.
an image of a chemical structure CID 129849378

N-Acetyl-4-aminophenol-d3

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,3,6-trideuterio-4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
3.
an image of a chemical structure CID 129735905

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N,2,2,2-tetradeuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
4.
an image of a chemical structure CID 56632159

Acetaminophen-(ring-d4); Acetaminophen-D4 solution; SCHEMBL887976

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(2,3,6-trideuterio-4-hydroxyphenyl)acetamide
Create Date:
2012-02-26
5.
an image of a chemical structure CID 54294462

MW:
152.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2011-12-04
6.
an image of a chemical structure CID 45379481

DTXSID50670171; 4-ACETAMIDOPHENOL-RING-UL-14C; 90135-67-4 ...

MW:
163.120
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxy(1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl)ace...
Create Date:
2010-05-17
7.
an image of a chemical structure CID 12205927

Acetaminophen-d3; 60902-28-5; 2,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide ...

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
2,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2007-02-07
8.
an image of a chemical structure CID 12205925

Acetaminophen-d4; Paracetamol-d4; 64315-36-2 ...

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide
Create Date:
2007-02-07
9.
an image of a chemical structure CID 1983

acetaminophen; Paracetamol; 4-Acetamidophenol ...

MW:
151.160
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2004-09-16
10.
an image of a chemical structure CID 153907716

N([13C](=O)C)C1=CC=C(O)C=C1

MW:
152.150
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2020-08-14
11.
an image of a chemical structure CID 145676293

MW:
167.200
g/mol
MF:
C9H13NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide;methane
Create Date:
2019-12-12
12.
an image of a chemical structure CID 138396034

DTXSID50892679; N-[4-(~2~H)Hydroxyphenyl](N-~2~H)acetamide

MW:
153.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(4-deuteriooxyphenyl)acetamide
Create Date:
2019-06-20
13.
an image of a chemical structure CID 91249665

MW:
181.230
g/mol
MF:
C10H15NO2
IUPAC name:
ethane;N-(4-hydroxyphenyl)acetamide
Create Date:
2015-03-17
14.
an image of a chemical structure CID 68110089

paracetamol monohydrate; 4-hydroxyacetanilide hydrate; SCHEMBL10325382 ...

MW:
169.180
g/mol
MF:
C8H11NO3
IUPAC name:
N-(4-hydroxyphenyl)acetamide;hydrate
Create Date:
2012-11-30
15.
an image of a chemical structure CID 10464506

MW:
152.160
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2006-10-25
16.
an image of a chemical structure CID 153899050

C(C)(=O)NC1=CC=C(O[Zr])C=C1

MW:
242.390
g/mol
MF:
C8H9NO2Zr
IUPAC name:
N-(4-hydroxyphenyl)acetamide;zirconium
Create Date:
2020-08-14
17.
an image of a chemical structure CID 144003985

MW:
211.300
g/mol
MF:
C12H21NO2
IUPAC name:
ethane;N-(4-hydroxyphenyl)acetamide
Create Date:
2019-12-07
18.
an image of a chemical structure CID 140999210

MW:
187.190
g/mol
MF:
C8H13NO4
IUPAC name:
N-(4-hydroxyphenyl)acetamide;dihydrate
Create Date:
2019-12-06
19.
an image of a chemical structure CID 91304928

MW:
195.260
g/mol
MF:
C11H17NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide;propane
Create Date:
2015-03-17
20.
an image of a chemical structure CID 87689257

SCHEMBL4552506

MW:
348.130
g/mol
MF:
C8H9AuNO2
IUPAC name:
gold;N-(4-hydroxyphenyl)acetamide
Create Date:
2015-02-12
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center