Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 16

1.
an image of a chemical structure CID 87576374

SCHEMBL3798074

MW:
950.900
g/mol
MF:
C40H30F8O10S4
IUPAC name:
bis(4-hydroxyphenyl)-phenylsulfanium;1,1,2,2,3,3,4,4-octaflu...
Create Date:
2015-02-12
2.
an image of a chemical structure CID 153823051

OC1=CC=C(C=C1)S(=O)(=O)C1=C(C=CC=C1)S(=O)(=O)C1=C(C=CC=C1)S(=O)(=O)C1=CC=C(C=C1)O

MW:
530.600
g/mol
MF:
C24H18O8S3
IUPAC name:
4-[2-[2-(4-hydroxyphenyl)sulfonylphenyl]sulfonylphenyl]sulfo...
Create Date:
2020-08-14
3.
an image of a chemical structure CID 140465188

MW:
436.500
g/mol
MF:
C24H20O4S2
IUPAC name:
[(4-hydroxyphenyl)-diphenyl-lambda4-sulfanyl] benzenesulfona...
Create Date:
2019-12-06
4.
an image of a chemical structure CID 140174679

MW:
436.500
g/mol
MF:
C24H20O4S2
IUPAC name:
(triphenyl-lambda4-sulfanyl) 4-hydroxybenzenesulfonate
Create Date:
2019-12-06
5.
an image of a chemical structure CID 90123840

SCHEMBL15676270

MW:
468.500
g/mol
MF:
C24H20O6S2
IUPAC name:
[tris(4-hydroxyphenyl)-lambda4-sulfanyl] benzenesulfonate
Create Date:
2015-02-13
6.
an image of a chemical structure CID 87266843

SCHEMBL1615067

MW:
950.900
g/mol
MF:
C40H30F8O10S4
IUPAC name:
bis[bis(4-hydroxyphenyl)-phenyl-lambda4-sulfanyl] 1,1,2,2,3,...
Create Date:
2015-02-12
7.
an image of a chemical structure CID 69242868

SCHEMBL4923956

MW:
468.500
g/mol
MF:
C24H20O6S2
IUPAC name:
4-(4-hydroxyphenyl)sulfanylphenol;4-(4-hydroxyphenyl)sulfony...
Create Date:
2012-11-30
8.
an image of a chemical structure CID 67302784

SCHEMBL2168578

MW:
484.500
g/mol
MF:
C24H20O7S2
IUPAC name:
4-(4-hydroxyphenyl)sulfinylphenol;4-(4-hydroxyphenyl)sulfony...
Create Date:
2012-11-30
9.
an image of a chemical structure CID 58288744

SCHEMBL12534658

MW:
530.600
g/mol
MF:
C24H18O8S3
IUPAC name:
[4-[4-(4-hydroxyphenyl)sulfonyloxyphenyl]sulfanylphenyl] 4-h...
Create Date:
2012-08-19
10.
an image of a chemical structure CID 22389889

SCHEMBL2895606

MW:
436.500
g/mol
MF:
C24H20O4S2
IUPAC name:
benzenesulfonate;(4-hydroxyphenyl)-diphenylsulfanium
Create Date:
2007-12-05
11.
an image of a chemical structure CID 153823050

OC1=CC=C(C=C1)SC1=C(C=CC=C1)S(=O)(=O)C1=C(C=CC=C1)SC1=CC=C(C=C1)O

MW:
466.600
g/mol
MF:
C24H18O4S3
IUPAC name:
4-[2-[2-(4-hydroxyphenyl)sulfanylphenyl]sulfonylphenyl]sulfa...
Create Date:
2020-08-14
12.
an image of a chemical structure CID 148717770

MW:
435.500
g/mol
MF:
C24H19O4S2+
IUPAC name:
[4-(benzenesulfonyl)phenyl]-bis(4-hydroxyphenyl)sulfanium
Create Date:
2020-08-12
13.
an image of a chemical structure CID 71414039

DTXSID20833534; 86031-13-2; Carbonic acid--4-(benzenesulfonyl)phenol (1/2)

MW:
530.600
g/mol
MF:
C25H22O9S2
IUPAC name:
4-(benzenesulfonyl)phenol;carbonic acid
Create Date:
2013-05-22
14.
an image of a chemical structure CID 70152807

SCHEMBL7647498

MW:
452.500
g/mol
MF:
C24H20O5S2
IUPAC name:
4-[[bis(4-hydroxyphenyl)-oxo-lambda6-sulfanylidene]-(4-hydro...
Create Date:
2012-12-01
15.
an image of a chemical structure CID 18407938

SCHEMBL7647495

MW:
452.500
g/mol
MF:
C24H20O5S2
IUPAC name:
4-(4-hydroxyphenyl)sulfanylphenol;4-(4-hydroxyphenyl)sulfiny...
Create Date:
2007-12-04
16.
an image of a chemical structure CID 18361636

SCHEMBL6905378

MW:
438.500
g/mol
MF:
C24H22O6S
IUPAC name:
4-(4-hydroxyphenyl)sulfonylphenol;phenol
Create Date:
2007-12-04
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center