Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 58

1.
an image of a chemical structure CID 138396058

4,4'-Sulfonyldi(~2~H)phenol; DTXSID80892708

MW:
252.280
g/mol
MF:
C12H10O4S
IUPAC name:
1-deuteriooxy-4-(4-deuteriooxyphenyl)sulfonylbenzene
Create Date:
2019-06-20
2.
an image of a chemical structure CID 146762127

MW:
266.270
g/mol
MF:
C12H10O5S
IUPAC name:
4-(4-hydroperoxyphenyl)sulfonylphenol
Create Date:
2020-08-12
3.
an image of a chemical structure CID 148119005

MW:
235.280
g/mol
MF:
C12H11O3S+
IUPAC name:
[(4-hydroxyphenyl)-oxo-phenyl-lambda6-sulfanylidene]oxidaniu...
Create Date:
2020-08-12
4.
an image of a chemical structure CID 87177636

SCHEMBL931146; [Ti]Oc1ccc(cc1)S(=O)(=O)c1ccccc1

MW:
282.140
g/mol
MF:
C12H10O3STi
IUPAC name:
4-(benzenesulfonyl)phenol;titanium
Create Date:
2015-02-12
5.
an image of a chemical structure CID 68311567

SCHEMBL12531363

MW:
252.290
g/mol
MF:
C12H12O4S
IUPAC name:
4-(4-hydroxycyclohexa-1,3-dien-1-yl)sulfonylphenol
Create Date:
2012-11-30
6.
an image of a chemical structure CID 154153687

OC1=CC=C(C=C1)S(=O)(=O)C1=C(C=CC=C1)[SeH]

MW:
313.240
g/mol
MF:
C12H10O3SSe
IUPAC name:
4-(2-selanylphenyl)sulfonylphenol
Create Date:
2020-08-14
7.
an image of a chemical structure CID 154134711

OC1=CC=C(C=C1)S(=O)(=O)C1=CC=C(C=C1)[SeH]

MW:
313.240
g/mol
MF:
C12H10O3SSe
IUPAC name:
4-(4-selanylphenyl)sulfonylphenol
Create Date:
2020-08-14
8.
an image of a chemical structure CID 153140959

MW:
210.250
g/mol
MF:
C10H10O3S
IUPAC name:
4-buta-1,3-dien-2-ylsulfonylphenol
Create Date:
2020-08-13
9.
an image of a chemical structure CID 152872054

MW:
266.310
g/mol
MF:
C13H14O4S
IUPAC name:
4-[(2E,4E)-5-hydroxyhepta-2,4,6-trien-2-yl]sulfonylphenol
Create Date:
2020-08-13
10.
an image of a chemical structure CID 150272555

MW:
294.320
g/mol
MF:
C14H14O5S
IUPAC name:
4-(4-ethylperoxyphenyl)sulfonylphenol
Create Date:
2020-08-12
11.
an image of a chemical structure CID 149407140

MW:
252.290
g/mol
MF:
C12H12O4S
IUPAC name:
4-[(1S)-4-hydroxycyclohexa-2,4-dien-1-yl]sulfonylphenol
Create Date:
2020-08-12
12.
an image of a chemical structure CID 152892939

MW:
248.300
g/mol
MF:
C13H12O3S
IUPAC name:
4-[(4-hydroxyphenyl)-methylidene-oxo-lambda6-sulfanyl]phenol
Create Date:
2020-08-13
13.
an image of a chemical structure CID 152175528

MW:
291.280
g/mol
MF:
C12H9N3O4S
IUPAC name:
4-(4-azidooxyphenyl)sulfonylphenol
Create Date:
2020-08-13
14.
an image of a chemical structure CID 151923214

MW:
282.300
g/mol
MF:
C12H10O4S2
IUPAC name:
4-(4-hydroxyphenyl)sulfanylbenzenesulfonic acid
Create Date:
2020-08-13
15.
an image of a chemical structure CID 151811839

MW:
314.300
g/mol
MF:
C12H10O6S2
IUPAC name:
4-(4-hydroxyphenyl)sulfonylbenzenesulfonic acid
Create Date:
2020-08-13
16.
an image of a chemical structure CID 151275990

MW:
282.270
g/mol
MF:
C12H10O6S
IUPAC name:
1-hydroperoxy-4-(4-hydroperoxyphenyl)sulfonylbenzene
Create Date:
2020-08-13
17.
an image of a chemical structure CID 149037219

MW:
282.310
g/mol
MF:
C13H14O5S
IUPAC name:
4-[(3Z,5E)-5-hydroperoxyhepta-1,3,5-trien-2-yl]sulfonylpheno...
Create Date:
2020-08-12
18.
an image of a chemical structure CID 147934754

MW:
212.270
g/mol
MF:
C10H12O3S
IUPAC name:
4-[(E)-but-2-en-2-yl]sulfonylphenol
Create Date:
2020-08-12
19.
an image of a chemical structure CID 147141453

MW:
266.310
g/mol
MF:
C13H14O4S
IUPAC name:
4-(4-hydroxy-1-methylcyclohexa-2,4-dien-1-yl)sulfonylphenol
Create Date:
2020-08-12
20.
an image of a chemical structure CID 143662125

SCHEMBL21999096

MW:
250.320
g/mol
MF:
C13H14O3S
IUPAC name:
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfonylphenol
Create Date:
2019-12-07
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center