Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 84

1.
an image of a chemical structure CID 15625

2,3,7,8-TETRACHLORODIBENZO-P-DIOXIN; TCDD; Dioxin ...

MW:
322.000
g/mol
MF:
C12H4Cl4O2
IUPAC name:
2,3,7,8-tetrachlorodibenzo-p-dioxin
Create Date:
2005-03-27
2.
an image of a chemical structure CID 158816

85508-50-5; Dibenzo(b,e)(1,4)dioxin, 2,3,7,8-tetra(chloro-37Cl)-; DTXSID40234721

MW:
328.020
g/mol
MF:
C12H4Cl4O2
IUPAC name:
2,3,7,8-tetrakis(37Cl)(chloranyl)dibenzo-p-dioxin
Create Date:
2005-08-08
3.
an image of a chemical structure CID 156712

76523-40-5; Dibenzo(b,e)(1,4)dioxin-13C12, 2,3,7,8-tetrachloro-; DTXSID60227332

MW:
333.900
g/mol
MF:
C12H4Cl4O2
IUPAC name:
2,3,7,8-tetrachlorodibenzo-p-dioxin
Create Date:
2005-08-08
4.
an image of a chemical structure CID 69940835

SCHEMBL6930992

MW:
358.400
g/mol
MF:
C12H5Cl5O2
IUPAC name:
2,3,7,8-tetrachlorodibenzo-p-dioxin;hydrochloride
Create Date:
2012-12-01
5.
an image of a chemical structure CID 67418390

SCHEMBL2464843

MW:
356.000
g/mol
MF:
C12H6Cl4O2S
IUPAC name:
sulfane;2,3,7,8-tetrachlorodibenzo-p-dioxin
Create Date:
2012-11-30
6.
an image of a chemical structure CID 67412859

SCHEMBL2449395

MW:
402.900
g/mol
MF:
C12H5BrCl4O2
IUPAC name:
2,3,7,8-tetrachlorodibenzo-p-dioxin;hydrobromide
Create Date:
2012-11-30
7.
an image of a chemical structure CID 69495797

SCHEMBL5579945; 3,3,7,8-tetrachloro-2H-dibenzo-p-dioxin

MW:
324.000
g/mol
MF:
C12H6Cl4O2
IUPAC name:
3,3,7,8-tetrachloro-2H-dibenzo-p-dioxin
Create Date:
2012-12-01
8.
an image of a chemical structure CID 36614

2,3,7-TRICHLORODIBENZO-P-DIOXIN; UNII-UC7ILE15NN; 33857-28-2 ...

MW:
287.500
g/mol
MF:
C12H5Cl3O2
IUPAC name:
2,3,7-trichlorodibenzo-p-dioxin
Create Date:
2005-08-08
9.
10.
an image of a chemical structure CID 153694872

[125I]C1=CC2=C(OC3=C(O2)C=C(C(=C3)Cl)Cl)C=C1Cl

MW:
411.400
g/mol
MF:
C12H4Cl3IO2
IUPAC name:
2,3,7-trichloro-8-(125I)iodanyldibenzo-p-dioxin
Create Date:
2020-08-14
11.
an image of a chemical structure CID 67417164

SCHEMBL2461446; 2,3,7,8-tetrachloro-1-fluorodibenzo-p-dioxin

MW:
340.000
g/mol
MF:
C12H3Cl4FO2
IUPAC name:
2,3,7,8-tetrachloro-1-fluorodibenzo-p-dioxin
Create Date:
2012-11-30
12.
an image of a chemical structure CID 183435

112317-15-4; Dibenzo(b,e)(1,4)dioxin, 2,3,7-trichloro-8-fluoro-; 2-Fluoro-3,7,8-trichlorodibenzo-p-dioxin ...

MW:
305.500
g/mol
MF:
C12H4Cl3FO2
IUPAC name:
2,3,7-trichloro-8-fluorodibenzo-p-dioxin
Create Date:
2005-08-09
13.
an image of a chemical structure CID 163881

112317-17-6; 2-Iodo-3,7,8-trichlorodibenzo-4-dioxin; Cl3-Dpd ...

MW:
413.400
g/mol
MF:
C12H4Cl3IO2
IUPAC name:
2,3,7-trichloro-8-iododibenzo-p-dioxin
Create Date:
2005-08-08
14.
an image of a chemical structure CID 129849831

1,2,3,3,7,8-hexachlorodibenzo-p-dioxin

MW:
392.900
g/mol
MF:
C12H4Cl6O2
IUPAC name:
1,2,3,3,7,8-hexachloro-2H-dibenzo-p-dioxin
Create Date:
2017-09-13
15.
an image of a chemical structure CID 70279570

SCHEMBL8118239

MW:
396.100
g/mol
MF:
C16H14Cl4O3
IUPAC name:
ethoxyethane;2,3,7,8-tetrachlorodibenzo-p-dioxin
Create Date:
2012-12-01
16.
an image of a chemical structure CID 39730

2,3-DICHLORO-7,8-DIFLUORODIBENZO-P-DIOXIN; 50585-42-7; Dibenzo(b,e)(1,4)dioxin, 2,3-dichloro-7,8-difluoro- ...

MW:
289.060
g/mol
MF:
C12H4Cl2F2O2
IUPAC name:
2,3-dichloro-7,8-difluorodibenzo-p-dioxin
Create Date:
2005-08-08
17.
an image of a chemical structure CID 129695099

2,3,7,7-tetrachlorodibenzo-p-dioxin; O1C(CC(Cl)(Cl)C=C2)=C2OC2=C1C=C(Cl)C(Cl)=C2

MW:
324.000
g/mol
MF:
C12H6Cl4O2
IUPAC name:
2,2,7,8-tetrachloro-1H-dibenzo-p-dioxin
Create Date:
2017-09-13
18.
an image of a chemical structure CID 88112667

SCHEMBL7203357

MW:
657.700
g/mol
MF:
C16H8Cl12O2
IUPAC name:
2,3,7,8-tetrachlorodibenzo-p-dioxin;1,1,2,2-tetrachloroethan...
Create Date:
2015-02-12
19.
an image of a chemical structure CID 67900508

SCHEMBL9658818

MW:
539.300
g/mol
MF:
C12H3Cl3I2O2
IUPAC name:
3,7,8-trichloro-1,2-diiododibenzo-p-dioxin
Create Date:
2012-11-30
20.
an image of a chemical structure CID 12398688

6,7-dichloro-2,3-dihydrobenzo[b][1,4]dioxine; 67471-04-9; 6,7-Dichloro-2,3-dihydro-1,4-benzodioxine ...

MW:
205.030
g/mol
MF:
C8H6Cl2O2
IUPAC name:
6,7-dichloro-2,3-dihydro-1,4-benzodioxine
Create Date:
2007-02-08
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center