Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 842

1.
an image of a chemical structure CID 222656

97-67-6; L-Malic acid; L-(-)-Malic acid ...

MW:
134.090
g/mol
MF:
C4H6O5
IUPAC name:
(2S)-2-hydroxybutanedioic acid
Create Date:
2004-09-16
2.
an image of a chemical structure CID 71309560

180991-05-3; DTXSID60745925; (2S)-2-Hydroxy(1-~13~C)butanedioic acid ...

MW:
135.080
g/mol
MF:
C4H6O5
IUPAC name:
(2S)-2-hydroxy(113C)butanedioic acid
Create Date:
2013-05-17
3.
an image of a chemical structure CID 57539212

SCHEMBL13945199

MW:
140.120
g/mol
MF:
C4H6O5
IUPAC name:
dideuterio (3S)-2,2,3-trideuterio-3-deuteriooxybutanedioate
Create Date:
2012-08-18
4.
an image of a chemical structure CID 92824

D-(+)-malic acid; D-malic acid; 636-61-3 ...

MW:
134.090
g/mol
MF:
C4H6O5
IUPAC name:
(2R)-2-hydroxybutanedioic acid
Create Date:
2005-06-24
5.
an image of a chemical structure CID 525

malic acid; DL-malic acid; 6915-15-7 ...

MW:
134.090
g/mol
MF:
C4H6O5
IUPAC name:
2-hydroxybutanedioic acid
Create Date:
2004-09-16
6.
an image of a chemical structure CID 129883083

d1-malic

MW:
135.090
g/mol
MF:
C4H6O5
IUPAC name:
4-deuteriooxy-2-hydroxy-4-oxobutanoic acid
Create Date:
2017-09-13
7.
an image of a chemical structure CID 71309504

2,2,3-Trideuterio-3-hydroxybutanedioic acid; DL-Malic acid-2,3,3-d3; 104596-63-6 ...

MW:
137.110
g/mol
MF:
C4H6O5
IUPAC name:
2,2,3-trideuterio-3-hydroxybutanedioic acid
Create Date:
2013-05-17
8.
an image of a chemical structure CID 71309137

143435-96-5; DTXSID90745771; 2-Hydroxy(2-~13~C)butanedioic acid ...

MW:
135.080
g/mol
MF:
C4H6O5
IUPAC name:
2-hydroxy(213C)butanedioic acid
Create Date:
2013-05-17
9.
an image of a chemical structure CID 53684892

SCHEMBL12296034

MW:
135.090
g/mol
MF:
C4H6O5
IUPAC name:
2-deuterio-2-hydroxybutanedioic acid
Create Date:
2011-12-03
10.
an image of a chemical structure CID 25214506

L-Malic acid-1-13C; 180991-05-3

MW:
135.080
g/mol
MF:
C4H6O5
IUPAC name:
2-hydroxy(113C)butanedioic acid
Create Date:
2009-04-13
11.
an image of a chemical structure CID 137262652

MW:
138.060
g/mol
MF:
C4H6O5
IUPAC name:
(2R)-2-hydroxy(1,2,3,4-13C4)butanedioic acid
Create Date:
2019-01-26
12.
an image of a chemical structure CID 136776853

MW:
136.100
g/mol
MF:
C4H6O5
IUPAC name:
(2R,3S)-2-deuterio-3-deuteriooxybutanedioic acid
Create Date:
2019-01-25
13.
an image of a chemical structure CID 16052256

MW:
136.070
g/mol
MF:
C4H6O5
IUPAC name:
(2R)-2-hydroxy(2,4-13C2)butanedioic acid
Create Date:
2007-05-08
14.
an image of a chemical structure CID 153798249

C(=O)([O-])C(O)(C(O)C(=O)[O-])[2H]

MW:
149.080
g/mol
MF:
C4H4O6-2
IUPAC name:
2-deuterio-2,3-dihydroxybutanedioate
Create Date:
2020-08-14
15.
an image of a chemical structure CID 153713243

[13C]([13CH](O)[13CH2]C(=O)[O-])(=O)[O-]

MW:
135.050
g/mol
MF:
C4H4O5-2
IUPAC name:
2-hydroxy(1,2,3-13C3)butanedioate
Create Date:
2020-08-14
16.
an image of a chemical structure CID 153712794

[13C]([13CH](O)[13CH2]C(=O)O)(=O)O

MW:
137.070
g/mol
MF:
C4H6O5
IUPAC name:
2-hydroxy(1,2,3-13C3)butanedioic acid
Create Date:
2020-08-14
17.
an image of a chemical structure CID 153711399

C(C(O)(C(C(=O)[O-])[2H])[2H])(=O)[O-]

MW:
134.080
g/mol
MF:
C4H4O5-2
IUPAC name:
2,3-dideuterio-2-hydroxybutanedioate
Create Date:
2020-08-14
18.
an image of a chemical structure CID 153711397

C([13CH](O)[13CH2][13C](=O)[O-])(=O)[O-]

MW:
135.050
g/mol
MF:
C4H4O5-2
IUPAC name:
2-hydroxy(2,3,4-13C3)butanedioate
Create Date:
2020-08-14
19.
an image of a chemical structure CID 153697153

OC(C(=O)[O-])(O)C(O)C(=O)[O-]

MW:
164.070
g/mol
MF:
C4H4O7-2
IUPAC name:
2,2,3-trihydroxybutanedioate
Create Date:
2020-08-14
20.
an image of a chemical structure CID 153695699

C(C(O)[13CH2]C(=O)[O-])(=O)[O-]

MW:
133.060
g/mol
MF:
C4H4O5-2
IUPAC name:
2-hydroxy(313C)butanedioate
Create Date:
2020-08-14
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center