Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 47719

1.
2.
an image of a chemical structure CID 141214974

MW:
253.300
g/mol
MF:
C20H12
IUPAC name:
1-deuteriobenzo[a]pyrene
Create Date:
2019-12-06
3.
an image of a chemical structure CID 129850106

benzo[a]pyrene-d10

MW:
262.400
g/mol
MF:
C20H12
IUPAC name:
1,2,3,4,5,6,7,8,9,10-decadeuteriobenzo[a]pyrene
Create Date:
2017-09-13
4.
an image of a chemical structure CID 15590256

Benzo[a]pyrene-7-14C; Benzo(a)pyrene-7-14C; AKOS015916723

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
benzo[a]pyrene
Create Date:
2007-02-12
5.
an image of a chemical structure CID 12202235

Benzo[a]pyrene-d12; 63466-71-7; Benzo[a]pyrene D12 ...

MW:
264.400
g/mol
MF:
C20H12
IUPAC name:
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]pyrene
Create Date:
2007-02-07
6.
an image of a chemical structure CID 6911868

Benzo[a]pyrene-7,8-d2; 7,8-dideuteriobenzo[a]pyrene; 206752-38-7 ...

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
7,8-dideuteriobenzo[a]pyrene
Create Date:
2006-07-04
7.
an image of a chemical structure CID 6911867

Benzo[a]pyrene-8-d; 8-deuteriobenzo[a]pyrene; 206752-39-8 ...

MW:
253.300
g/mol
MF:
C20H12
IUPAC name:
8-deuteriobenzo[a]pyrene
Create Date:
2006-07-04
8.
an image of a chemical structure CID 6911866

Benzo[a]pyrene-7-d; 7-deuteriobenzo[a]pyrene; 68041-22-5 ...

MW:
253.300
g/mol
MF:
C20H12
IUPAC name:
7-deuteriobenzo[a]pyrene
Create Date:
2006-07-04
9.
an image of a chemical structure CID 155791381

MW:
278.300
g/mol
MF:
C22H14
IUPAC name:
hexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-1(20),2(7),3...
Create Date:
2021-02-22
10.
an image of a chemical structure CID 154585897

coronene-d10

MW:
310.400
g/mol
MF:
C24H12
IUPAC name:
1,2,3,4,5,6,7,8,9,10-decadeuteriocoronene
Create Date:
2020-09-25
11.
an image of a chemical structure CID 154416450

C1=CC=C2C3=C1C=1C=CC=CC=1C=C3CC1=CC=CC=C21

MW:
266.300
g/mol
MF:
C21H14
IUPAC name:
pentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1,3,5,7,9(21),1...
Create Date:
2020-08-14
12.
an image of a chemical structure CID 153865344

[2H]C1=CC=C2C=CC(=C3C4=C(C=CC5=CC=C(C(C1=C23)=C45)[2H])[2H])[2H]

MW:
256.300
g/mol
MF:
C20H12
IUPAC name:
1,6,7,12-tetradeuterioperylene
Create Date:
2020-08-14
13.
an image of a chemical structure CID 153695530

C=1(C=C(C=2C=CC3=C(C4=C(C=5C=CC=1C=2C=53)C=CC=C4)[3H])[3H])[3H]

MW:
258.300
g/mol
MF:
C20H12
IUPAC name:
1,3,6-tritritiobenzo[a]pyrene
Create Date:
2020-08-14
14.
an image of a chemical structure CID 153693924

[14CH]1=CC=C2C=CC=3C=C4C(=C5C=CC1=C2C5=3)C=CC=C4

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
benzo[a]pyrene
Create Date:
2020-08-14
15.
an image of a chemical structure CID 153639112

perylene-d4

MW:
256.300
g/mol
MF:
C20H12
IUPAC name:
1,2,3,4-tetradeuterioperylene
Create Date:
2020-08-14
16.
an image of a chemical structure CID 149956441

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
3,4-dideuterioperylene
Create Date:
2020-08-12
17.
an image of a chemical structure CID 146869092

MW:
326.400
g/mol
MF:
C26H14
IUPAC name:
1,2-dimethylidenecoronene
Create Date:
2020-08-12
18.
an image of a chemical structure CID 145815453

MW:
276.300
g/mol
MF:
C22H12
IUPAC name:
hexacyclo[14.2.2.24,7.02,15.03,8.09,14]docosa-1,3,5,7,9,11,1...
Create Date:
2020-01-24
19.
an image of a chemical structure CID 145815450

MW:
326.400
g/mol
MF:
C26H14
IUPAC name:
heptacyclo[18.2.2.24,7.02,19.03,8.09,18.011,16]hexacosa-1,3,...
Create Date:
2020-01-24
20.
an image of a chemical structure CID 144696383

MW:
350.400
g/mol
MF:
C28H14
Create Date:
2019-12-07
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center