Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 21

1.
an image of a chemical structure CID 26177

13674-87-8; TDCPP; Tris(1,3-dichloro-2-propyl)phosphate ...

MW:
430.900
g/mol
MF:
C9H15Cl6O4P
IUPAC name:
tris(1,3-dichloropropan-2-yl) phosphate
Create Date:
2005-03-27
2.
an image of a chemical structure CID 50203

68460-03-7; Bis(1,3-dichloro-2-propyl)-2,3-dichloro-1-propyl phosphate; Bis[2-chloro-1-(chloromethyl)ethyl] 2,3-dichloropropyl phosphate ...

MW:
430.900
g/mol
MF:
C9H15Cl6O4P
IUPAC name:
bis(1,3-dichloropropan-2-yl) 2,3-dichloropropyl phosphate
Create Date:
2005-03-27
3.
an image of a chemical structure CID 57353142

Bis(1,3-dichloro-2-propyl) phosphate; AKOS030239635; bis(1,3-dichloropropan-2-yl) phosphate

MW:
318.900
g/mol
MF:
C6H10Cl4O4P-
IUPAC name:
bis(1,3-dichloropropan-2-yl) phosphate
Create Date:
2012-07-12
4.
an image of a chemical structure CID 20563907

SCHEMBL4644603

MW:
430.900
g/mol
MF:
C9H15Cl6O4P
IUPAC name:
tris(1,1-dichloropropan-2-yl) phosphate
Create Date:
2007-12-05
5.
an image of a chemical structure CID 188119

bis(1,3-dichloropropan-2-yl) hydrogen phosphate; Bis(1,3-dichloro-2-propyl) phosphate; 72236-72-7 ...

MW:
319.900
g/mol
MF:
C6H11Cl4O4P
IUPAC name:
bis(1,3-dichloropropan-2-yl) hydrogen phosphate
Create Date:
2005-08-09
6.
an image of a chemical structure CID 12500059

DTXSID50500520; 14622-42-5; Bis[(1,3-dichloropropan-2-yl)oxy](oxo)phosphanium

MW:
302.900
g/mol
MF:
C6H10Cl4O3P+
IUPAC name:
bis(1,3-dichloropropan-2-yloxy)-oxophosphanium
Create Date:
2007-02-08
7.
an image of a chemical structure CID 154278582

P(=O)(OCCCl)(OCC(CCl)Cl)OCC(CCl)Cl

MW:
382.400
g/mol
MF:
C8H14Cl5O4P
IUPAC name:
2-chloroethyl bis(2,3-dichloropropyl) phosphate
Create Date:
2020-08-14
8.
an image of a chemical structure CID 141346716

MW:
279.090
g/mol
MF:
C8H17Cl2O4P
IUPAC name:
bis(1-chloropropan-2-yl) ethyl phosphate
Create Date:
2019-12-06
9.
an image of a chemical structure CID 102006008

Phosphoric acid (1-chloromethyl-2-chloroethyl)diethyl ester

MW:
265.070
g/mol
MF:
C7H15Cl2O4P
IUPAC name:
1,3-dichloropropan-2-yl diethyl phosphate
Create Date:
2015-12-24
10.
an image of a chemical structure CID 92178663

SCHEMBL20876906; ZINC2560399; UNII-29WKV18KR6 component JZZBTMVTLBHJHL-IWSPIJDZSA-N

MW:
430.900
g/mol
MF:
C9H15Cl6O4P
IUPAC name:
tris[(2S)-2,3-dichloropropyl] phosphate
Create Date:
2015-12-10
11.
an image of a chemical structure CID 54405781

SCHEMBL11712361; tris(1,4,4,4-tetrachlorobutan-2-yl) phosphate

MW:
679.600
g/mol
MF:
C12H15Cl12O4P
IUPAC name:
tris(1,4,4,4-tetrachlorobutan-2-yl) phosphate
Create Date:
2011-12-04
12.
an image of a chemical structure CID 22833419

Bis(2-chloro-1-methylethyl) 2-chloropropyl phosphate; 76025-08-6; Phosphoric acid, bis(2-chloro-1-methylethyl) 2-chloropropyl ester ...

MW:
327.600
g/mol
MF:
C9H18Cl3O4P
IUPAC name:
bis(1-chloropropan-2-yl) 2-chloropropyl phosphate
Create Date:
2007-12-05
13.
an image of a chemical structure CID 22563554

SCHEMBL6286301

MW:
369.600
g/mol
MF:
C12H24Cl3O4P
IUPAC name:
tris(3-chlorobutan-2-yl) phosphate
Create Date:
2007-12-05
14.
an image of a chemical structure CID 21512369

1,3-dichloropropan-2-yl dimethyl phosphate

MW:
237.020
g/mol
MF:
C5H11Cl2O4P
IUPAC name:
1,3-dichloropropan-2-yl dimethyl phosphate
Create Date:
2007-12-05
15.
an image of a chemical structure CID 13363031

MW:
414.900
g/mol
MF:
C9H15Cl6O3P
IUPAC name:
1,3-dichloro-2-[1,3-dichloropropan-2-yl(1,3-dichloropropan-2...
Create Date:
2007-02-08
16.
an image of a chemical structure CID 567512

137888-35-8; 1-chloropropan-2-yl bis(3-chloropropyl) phosphate; Phosphoric acid, 2-chloro-1-methylethyl bis(3-chloropropyl) ester ...

MW:
327.600
g/mol
MF:
C9H18Cl3O4P
IUPAC name:
1-chloropropan-2-yl bis(3-chloropropyl) phosphate
Create Date:
2005-03-27
17.
an image of a chemical structure CID 93459

Bis(2-chloropropyl) 2-chloro-1-methylethyl phosphate; 76649-15-5; Bis(2-chloropropyl) 2-chloroisopropyl phosphate ...

MW:
327.600
g/mol
MF:
C9H18Cl3O4P
IUPAC name:
1-chloropropan-2-yl bis(2-chloropropyl) phosphate
Create Date:
2005-08-08
18.
19.
20.
an image of a chemical structure CID 81228

tris(1,3-dichloropropan-2-yl) phosphite; 2-Propanol, 1,3-dichloro-, phosphite (3:1); 6749-73-1 ...

MW:
414.900
g/mol
MF:
C9H15Cl6O3P
IUPAC name:
tris(1,3-dichloropropan-2-yl) phosphite
Create Date:
2005-08-08
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center