Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 539

1.
an image of a chemical structure CID 2796

clofibrate; 637-07-0; Ethyl clofibrate ...

MW:
242.700
g/mol
MF:
C12H15ClO3
IUPAC name:
ethyl 2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2004-09-16
2.
an image of a chemical structure CID 71314923

Clofibrate-d4; 1189654-03-2; DTXSID40747366 ...

MW:
246.720
g/mol
MF:
C12H15ClO3
IUPAC name:
ethyl 2-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-2-methylprop...
Create Date:
2013-05-17
3.
an image of a chemical structure CID 70532765

SCHEMBL11187010

MW:
267.000
g/mol
MF:
C12H15ClMgO3
Create Date:
2012-12-01
4.
an image of a chemical structure CID 70532393

SCHEMBL11184809

MW:
281.790
g/mol
MF:
C12H15ClKO3
Create Date:
2012-12-01
5.
an image of a chemical structure CID 69503174

SCHEMBL5605019

MW:
282.770
g/mol
MF:
C12H15CaClO3
Create Date:
2012-12-01
6.
an image of a chemical structure CID 21392321

AKOS017265411; propyl 2-(4-chlorophenoxy)-2-methylpropanoate

MW:
256.720
g/mol
MF:
C13H17ClO3
IUPAC name:
propyl 2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2007-12-05
7.
8.
an image of a chemical structure CID 20526236

tert-butyl 2-(4-chlorophenoxy)acetate; SCHEMBL6695825; tert.-butyl 4-chlorophenoxyacetate ...

MW:
242.700
g/mol
MF:
C12H15ClO3
IUPAC name:
tert-butyl 2-(4-chlorophenoxy)acetate
Create Date:
2007-12-05
9.
an image of a chemical structure CID 41343

Methyl 2-(4-chlorophenoxy)-2-methylpropanoate; 55162-41-9; clofibric acid methyl ester ...

MW:
228.670
g/mol
MF:
C11H13ClO3
IUPAC name:
methyl 2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2005-03-27
10.
an image of a chemical structure CID 15579

butyl 2-(4-chlorophenoxy)-2-methylpropanoate; 1713-14-0; Mecoprop, ethyl ester ...

MW:
270.750
g/mol
MF:
C14H19ClO3
IUPAC name:
butyl 2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2005-08-08
11.
12.
13.
an image of a chemical structure CID 6918953

2-(4-chlorophenoxy)-2-methylpropanoate

MW:
213.640
g/mol
MF:
C10H10ClO3-
IUPAC name:
2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2006-07-28
14.
an image of a chemical structure CID 2781328

64416-88-2; isopropyl 2-(4-chlorophenoxy)-2-methylpropanoate; propan-2-yl 2-(4-chlorophenoxy)-2-methylpropanoate ...

MW:
256.720
g/mol
MF:
C13H17ClO3
IUPAC name:
propan-2-yl 2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2005-07-19
15.
an image of a chemical structure CID 218473

40698-24-6; Propanoic acid, 2-(4-chlorophenoxy)-2-methyl-, 2-(acetyloxy)ethyl ester; 2-(Acetyloxy)ethyl 2-(4-chlorophenoxy)-2-methylpropanoate ...

MW:
300.730
g/mol
MF:
C14H17ClO5
IUPAC name:
2-acetyloxyethyl 2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2005-08-09
16.
an image of a chemical structure CID 154710216

MW:
254.710
g/mol
MF:
C13H15ClO3
IUPAC name:
3-methylbut-3-enyl 2-(4-chlorophenoxy)acetate
Create Date:
2020-10-27
17.
an image of a chemical structure CID 154146491

ClC1=CC=C(OCC(=O)OOC(C)(C)C)C=C1

MW:
258.700
g/mol
MF:
C12H15ClO4
IUPAC name:
tert-butyl 2-(4-chlorophenoxy)ethaneperoxoate
Create Date:
2020-08-14
18.
an image of a chemical structure CID 154122087

ClC(CCCl)OC(C(C)(C)OC1=CC=C(C=C1)Cl)=O

MW:
325.600
g/mol
MF:
C13H15Cl3O3
IUPAC name:
1,3-dichloropropyl 2-(4-chlorophenoxy)-2-methylpropanoate
Create Date:
2020-08-14
19.
an image of a chemical structure CID 147352512

MW:
240.680
g/mol
MF:
C12H13ClO3
IUPAC name:
ethyl 2-(4-chlorocyclohexa-1,3-dien-5-yn-1-yl)oxy-2-methylpr...
Create Date:
2020-08-12
20.
an image of a chemical structure CID 146168409

MW:
259.690
g/mol
MF:
C12H14ClFO3
IUPAC name:
ethyl 2-(4-chloro-2-(18F)fluoranylphenoxy)-2-methylpropanoat...
Create Date:
2020-06-16
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center