Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 90

1.
an image of a chemical structure CID 439183

3-phospho-D-glycerate; 3-phosphoglyceric acid; 3-phospho-D-glyceric acid ...

MW:
186.060
g/mol
MF:
C3H7O7P
IUPAC name:
(2R)-2-hydroxy-3-phosphonooxypropanoic acid
Create Date:
2004-09-16
2.
an image of a chemical structure CID 5327006

3-phosphoglyceric acid; 3-phospho-L-glyceric acid; Glyceric acid-3-phosphate ...

MW:
186.060
g/mol
MF:
C3H7O7P
IUPAC name:
(2S)-2-hydroxy-3-phosphonooxypropanoic acid
Create Date:
2005-08-08
3.
an image of a chemical structure CID 724

3-phosphoglycerate; glycerate 3-phosphate; 3-phosphoglyceric acid ...

MW:
186.060
g/mol
MF:
C3H7O7P
IUPAC name:
2-hydroxy-3-phosphonooxypropanoic acid
Create Date:
2004-09-16
4.
an image of a chemical structure CID 149437166

OCC(C([O-])=O)OP(=O)=O

MW:
167.030
g/mol
MF:
C3H4O6P-
IUPAC name:
3-hydroxy-2-phosphooxypropanoate
Create Date:
2020-08-12
5.
an image of a chemical structure CID 148547117

OCC(O)C(=O)OP([O-])([O-])=O

MW:
184.040
g/mol
MF:
C3H5O7P-2
IUPAC name:
2,3-dihydroxypropanoyl phosphate
Create Date:
2020-08-12
6.
an image of a chemical structure CID 140671639

MW:
184.040
g/mol
MF:
C3H5O7P-2
IUPAC name:
[(2R)-2-carboxy-2-hydroxyethyl] phosphate
Create Date:
2019-12-06
7.
an image of a chemical structure CID 130125582

OCC(O)C(=O)OP(=O)=O

MW:
168.040
g/mol
MF:
C3H5O6P
Create Date:
2017-10-07
8.
an image of a chemical structure CID 129713663

P(=O)(=O)OCC(C(=O)O)O

MW:
168.040
g/mol
MF:
C3H5O6P
Create Date:
2017-09-13
9.
10.
an image of a chemical structure CID 121596718

Glyceric acid 3-phosphate

MW:
184.040
g/mol
MF:
C3H5O7P-2
IUPAC name:
(2-carboxy-2-hydroxyethyl) phosphate
Create Date:
2016-09-19
11.
an image of a chemical structure CID 60038355

2-phosphoglycerate(3-); 3-hydroxy-2-(phosphonatooxy)propanoate; 2-phosphonatoglycerate(3-) ...

MW:
183.030
g/mol
MF:
C3H4O7P-3
IUPAC name:
3-hydroxy-2-phosphonatooxypropanoate
Create Date:
2012-08-20
12.
an image of a chemical structure CID 42609794

D-3-phosphoglycerate

MW:
185.050
g/mol
MF:
C3H6O7P-
IUPAC name:
[(2R)-2-carboxy-2-hydroxyethyl] hydrogen phosphate
Create Date:
2009-06-19
13.
an image of a chemical structure CID 40467846

2-phosphonato-D-glycerate(3-); 2-phospho-D-glycerate; 2-phospho-(R)-glycerate ...

MW:
183.030
g/mol
MF:
C3H4O7P-3
IUPAC name:
(2R)-3-hydroxy-2-phosphonatooxypropanoate
Create Date:
2009-05-30
14.
an image of a chemical structure CID 20224990

SCHEMBL5579171

MW:
186.060
g/mol
MF:
C3H7O7P
IUPAC name:
phosphono 2,3-dihydroxypropanoate
Create Date:
2007-12-05
15.
an image of a chemical structure CID 4674825

Glyceric acid 2-phosphate

MW:
184.040
g/mol
MF:
C3H5O7P-2
IUPAC name:
(1-carboxy-2-hydroxyethyl) phosphate
Create Date:
2005-09-16
16.
an image of a chemical structure CID 447550

(S)-3-Hydroxy-2-(Phosphonooxy)Propanoic Acid; 4tim; ZINC3869231 ...

MW:
186.060
g/mol
MF:
C3H7O7P
IUPAC name:
(2S)-3-hydroxy-2-phosphonooxypropanoic acid
Create Date:
2005-06-24
17.
an image of a chemical structure CID 439278

2-Phospho-D-Glyceric Acid; 2-phospho-D-glycerate; D-Glycerate 2-phosphate ...

MW:
186.060
g/mol
MF:
C3H7O7P
IUPAC name:
(2R)-3-hydroxy-2-phosphonooxypropanoic acid
Create Date:
2004-09-16
18.
19.
an image of a chemical structure CID 150912102

MW:
246.000
g/mol
MF:
C3H4O6PSe-
IUPAC name:
(3-hydroxy-1-oxo-1-selenidooxypropan-2-yl)oxy-oxido-oxophosp...
Create Date:
2020-08-13
20.
an image of a chemical structure CID 149437517

[O-]C(=O)C(O)COP(=O)=O

MW:
167.030
g/mol
MF:
C3H4O6P-
IUPAC name:
2-hydroxy-3-phosphooxypropanoate
Create Date:
2020-08-12
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center