Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 148

1.
an image of a chemical structure CID 4477

niclosamide; 50-65-7; 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide ...

MW:
327.120
g/mol
MF:
C13H8Cl2N2O4
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide
Create Date:
2005-03-25
2.
an image of a chemical structure CID 140541889

MW:
363.600
g/mol
MF:
C13H9Cl3N2O4
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;hydro...
Create Date:
2019-12-06
3.
an image of a chemical structure CID 87255746

SCHEMBL1526777

MW:
390.130
g/mol
MF:
C13H9Cl2N3O7
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;nitri...
Create Date:
2015-02-12
4.
an image of a chemical structure CID 12296604

Niclosamide monohydrate; 73360-56-2; Niclosamide (monohydrate) ...

MW:
345.130
g/mol
MF:
C13H10Cl2N2O5
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;hydra...
Create Date:
2007-02-07
5.
an image of a chemical structure CID 145082203

MW:
357.200
g/mol
MF:
C15H14Cl2N2O4
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;ethan...
Create Date:
2019-12-07
6.
an image of a chemical structure CID 131878987

MW:
350.110
g/mol
MF:
C13H8Cl2N2NaO4
Create Date:
2017-12-18
7.
an image of a chemical structure CID 19027407

SCHEMBL8054842; CHEMBL4476635

MW:
327.120
g/mol
MF:
C13H8Cl2N2O4
IUPAC name:
5-chloro-N-(3-chloro-4-nitrophenyl)-2-hydroxybenzamide
Create Date:
2007-12-04
8.
an image of a chemical structure CID 148491191

MW:
342.200
g/mol
MF:
C14H11Cl2N2O4+
IUPAC name:
[3-chloro-4-[(5-chloro-2-hydroxybenzoyl)amino]phenyl]-methox...
Create Date:
2020-08-12
9.
an image of a chemical structure CID 139146209

Niclosamide-urea; 2,5-dichloro-4-nitrosalicylanilide, urea ?

MW:
387.200
g/mol
MF:
C14H12Cl2N4O5
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;urea
Create Date:
2019-10-03
10.
an image of a chemical structure CID 118050896

SCHEMBL16686086; 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzenecarboxamide

MW:
359.200
g/mol
MF:
C14H12Cl2N2O5
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;metha...
Create Date:
2016-02-23
11.
an image of a chemical structure CID 123443748

MW:
311.120
g/mol
MF:
C13H8Cl2N2O3
IUPAC name:
5-chloro-N-(2-chloro-4-nitrosophenyl)-2-hydroxybenzamide
Create Date:
2017-01-24
12.
an image of a chemical structure CID 67263658

SCHEMBL2060904

MW:
373.200
g/mol
MF:
C15H14Cl2N2O5
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;ethan...
Create Date:
2012-11-30
13.
an image of a chemical structure CID 3353792

5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-methylbenzamide; CBMicro_013177; Oprea1_848619 ...

MW:
341.100
g/mol
MF:
C14H10Cl2N2O4
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-3-methylbenzam...
Create Date:
2005-09-07
14.
an image of a chemical structure CID 3101739

Oprea1_713926; C13H7Cl3N2O4; CHEMBL1372394 ...

MW:
361.600
g/mol
MF:
C13H7Cl3N2O4
IUPAC name:
5-chloro-N-(2,6-dichloro-4-nitrophenyl)-2-hydroxybenzamide
Create Date:
2005-08-09
15.
an image of a chemical structure CID 154139861

MW:
355.200
g/mol
MF:
C15H12Cl2N2O4
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-3-ethyl-2-hydroxybenzami...
Create Date:
2020-08-14
16.
an image of a chemical structure CID 139597573

MW:
386.200
g/mol
MF:
C16H17Cl2N3O4
IUPAC name:
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;propa...
Create Date:
2019-11-22
17.
an image of a chemical structure CID 123810101

SCHEMBL22579689

MW:
313.130
g/mol
MF:
C13H10Cl2N2O3
IUPAC name:
5-chloro-N-[2-chloro-4-(hydroxyamino)phenyl]-2-hydroxybenzam...
Create Date:
2017-01-25
18.
an image of a chemical structure CID 44565834

CHEMBL475006; SCHEMBL16685326; [5-chloro-N-(2-chloro-4-nitrophenyl)]-2-hydroxybenzamide

MW:
327.120
g/mol
MF:
C13H8Cl2N2O4
IUPAC name:
N-(2,5-dichloro-4-nitrophenyl)-2-hydroxybenzamide
Create Date:
2010-01-26
19.
an image of a chemical structure CID 2844786

N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide; 32853-24-0; N-(2-chloro-4-nitrophenyl)-2 hydroxybenzamide ...

MW:
292.670
g/mol
MF:
C13H9ClN2O4
IUPAC name:
N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide
Create Date:
2005-07-28
20.
an image of a chemical structure CID 487721

5-chloro-2-hydroxy-N-(4-nitrophenyl)benzamide; Oprea1_427842; 5-chloro-4'-nitrosalicylanilide ...

MW:
292.670
g/mol
MF:
C13H9ClN2O4
IUPAC name:
5-chloro-2-hydroxy-N-(4-nitrophenyl)benzamide
Create Date:
2005-08-01
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center