Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 7779

1.
an image of a chemical structure CID 448537

diethylstilbestrol; 56-53-1; Stilbestrol ...

MW:
268.300
g/mol
MF:
C18H20O2
IUPAC name:
4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
Create Date:
2004-09-16
2.
an image of a chemical structure CID 129850000

diethylstilbestrol-d6; C(C(\C(\C=1C(=CC(O)=CC=1)[2H])=C(/C1=CC=C(O)C=C1)\CC)([2H])[2H])([2H])([2H])[2H]

MW:
274.400
g/mol
MF:
C18H20O2
IUPAC name:
3-deuterio-4-[(E)-1,1,1,2,2-pentadeuterio-4-(4-hydroxyphenyl...
Create Date:
2017-09-13
3.
an image of a chemical structure CID 12312955

91318-10-4; trans-Diethyl-1,1,1',1'-stilbestrol-3,3',5,5'-d8; DIETHYL-1,1,1',1'-D4-STILBESTROL-3,3',5,5'-D4 ...

MW:
276.400
g/mol
MF:
C18H20O2
IUPAC name:
2,6-dideuterio-4-[(E)-2,2,5,5-tetradeuterio-4-(3,5-dideuteri...
Create Date:
2007-02-07
4.
an image of a chemical structure CID 688057

cis-Diethylstilbestrol; cis-Diethyl Stilbestrol; 22610-99-7 ...

MW:
268.300
g/mol
MF:
C18H20O2
IUPAC name:
4-[(Z)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
Create Date:
2005-07-07
5.
an image of a chemical structure CID 3054

6898-97-1; Stilbestrol;DES; Phenol, 4,4'-(1,2-diethyl-1,2-ethenediyl)bis- ...

MW:
268.300
g/mol
MF:
C18H20O2
IUPAC name:
4-[4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
Create Date:
2005-03-25
6.
an image of a chemical structure CID 123654274

MW:
276.400
g/mol
MF:
C18H20O2
IUPAC name:
1,2,4,5-tetradeuterio-3-deuteriooxy-6-[4-(2,3-dideuterio-4-d...
Create Date:
2017-01-25
7.
an image of a chemical structure CID 123324104

MW:
274.400
g/mol
MF:
C18H20O2
IUPAC name:
3-deuterio-4-[4-(2,3,5,6-tetradeuterio-4-deuteriooxyphenyl)h...
Create Date:
2017-01-24
8.
an image of a chemical structure CID 90865129

MW:
269.400
g/mol
MF:
C18H20O2
IUPAC name:
3-deuterio-4-[4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
Create Date:
2015-03-16
9.
an image of a chemical structure CID 153695684

C(C(\C(\C1=C(C(=C(O)C(=C1)[2H])[2H])[2H])=C(/C1=CC=C(O)C=C1)\CC)([2H])[2H])([2H])([2H])[2H]

MW:
276.400
g/mol
MF:
C18H20O2
IUPAC name:
2,3,6-trideuterio-4-[(E)-1,1,1,2,2-pentadeuterio-4-(4-hydrox...
Create Date:
2020-08-14
10.
an image of a chemical structure CID 151154100

MW:
254.320
g/mol
MF:
C17H18O2
IUPAC name:
4-(3-hydroxy-4-phenylpent-3-enyl)phenol
Create Date:
2020-08-13
11.
an image of a chemical structure CID 129827160

methyl diethyl stilbestrol

MW:
282.400
g/mol
MF:
C19H22O2
IUPAC name:
4-[(E)-4-(4-hydroxyphenyl)hept-3-en-3-yl]phenol
Create Date:
2017-09-13
12.
an image of a chemical structure CID 129695237

diethylstilbestrol monohydrate

MW:
286.400
g/mol
MF:
C18H22O3
IUPAC name:
4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol;hydrate
Create Date:
2017-09-13
13.
an image of a chemical structure CID 91094063

MW:
258.350
g/mol
MF:
C17H22O2
IUPAC name:
4-butylphenol;4-methylphenol
Create Date:
2015-03-17
14.
an image of a chemical structure CID 87590231

SCHEMBL3889139

MW:
240.300
g/mol
MF:
C16H16O2
IUPAC name:
4-[(E)-3-(4-hydroxyphenyl)-2-methylprop-2-enyl]phenol
Create Date:
2015-02-12
15.
an image of a chemical structure CID 71085643

SCHEMBL14148460

MW:
254.320
g/mol
MF:
C17H18O2
IUPAC name:
4-[(E)-3-(4-hydroxyphenyl)pent-2-en-2-yl]phenol
Create Date:
2013-03-21
16.
an image of a chemical structure CID 70433234

SCHEMBL10747570

MW:
258.350
g/mol
MF:
C17H22O2
IUPAC name:
4-ethylphenol;4-propylphenol
Create Date:
2012-12-01
17.
an image of a chemical structure CID 69538495

SCHEMBL5707414

MW:
272.400
g/mol
MF:
C18H24O2
IUPAC name:
4-butylphenol;4-ethylphenol
Create Date:
2012-12-01
18.
an image of a chemical structure CID 69327408

SCHEMBL5137999

MW:
286.400
g/mol
MF:
C19H26O2
IUPAC name:
4-butylphenol;4-propylphenol
Create Date:
2012-12-01
19.
an image of a chemical structure CID 67303566

SCHEMBL2170631

MW:
244.330
g/mol
MF:
C16H20O2
IUPAC name:
4-butylphenol;phenol
Create Date:
2012-11-30
20.
an image of a chemical structure CID 66637187

SCHEMBL264319

MW:
326.500
g/mol
MF:
C22H30O2
IUPAC name:
butane;4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
Create Date:
2012-11-30
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center