Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 290

1.
an image of a chemical structure CID 4763

phenobarbital; Phenobarbitone; Phenobarbitol ...

MW:
232.230
g/mol
MF:
C12H12N2O3
IUPAC name:
5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2005-03-25
2.
an image of a chemical structure CID 131801051

Phenobarbital, C-13; 2,4,6(1H,3H,5H)-Pyrimidinetrione-2,4,5-13C3, 5-ethyl-5-phenyl-; 52947-04-3

MW:
235.210
g/mol
MF:
C12H12N2O3
IUPAC name:
5-ethyl-5-phenyl-(2,5,6-13C3)1,3-diazinane-2,4,6-trione
Create Date:
2017-11-26
3.
an image of a chemical structure CID 16217597

Phenobarbital-D5 (D-label on ring); 72793-46-5; 5-ethyl-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-diazinane-2,4,6-trione ...

MW:
237.270
g/mol
MF:
C12H12N2O3
IUPAC name:
5-ethyl-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-diazinane-2,4,...
Create Date:
2007-07-16
4.
an image of a chemical structure CID 12249714

Phenobarbital-d5; 73738-05-3; UNII-846FQL88QE ...

MW:
237.270
g/mol
MF:
C12H12N2O3
IUPAC name:
5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-1,3-diazinane-2,4,...
Create Date:
2007-02-07
5.
an image of a chemical structure CID 129638983

C(C=CC)C1(C(NC(NC1=O)=O)=O)C1=CC=CC=C1

MW:
258.270
g/mol
MF:
C14H14N2O3
IUPAC name:
5-but-2-enyl-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2017-09-13
6.
an image of a chemical structure CID 69902700

SCHEMBL6807467

MW:
249.270
g/mol
MF:
C12H15N3O3
IUPAC name:
azane;5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2012-12-01
7.
an image of a chemical structure CID 68950318

SCHEMBL4193755

MW:
233.240
g/mol
MF:
C12H13N2O3+
IUPAC name:
5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;hydron
Create Date:
2012-11-30
8.
an image of a chemical structure CID 66160

Phenylmethylbarbituric acid; Heptobarbital; Mephebarbital ...

MW:
218.210
g/mol
MF:
C11H10N2O3
IUPAC name:
5-methyl-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2005-03-26
9.
an image of a chemical structure CID 49321

67051-53-0; DTXSID90275543; 5-(2-Methyl-2-propenyl)-5-phenylbarbituric acid ...

MW:
258.270
g/mol
MF:
C14H14N2O3
IUPAC name:
5-(2-methylprop-2-enyl)-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2005-08-08
10.
an image of a chemical structure CID 41866

5-Phenyl-5-propylbarbituric acid; BARBITURIC ACID, 5-PHENYL-5-PROPYL-; 56410-95-8 ...

MW:
246.260
g/mol
MF:
C13H14N2O3
IUPAC name:
5-phenyl-5-propyl-1,3-diazinane-2,4,6-trione
Create Date:
2005-07-15
11.
an image of a chemical structure CID 146627787

SCHEMBL22032658

MW:
295.780
g/mol
MF:
C12H12CuN2O3
IUPAC name:
copper;5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2020-06-27
12.
an image of a chemical structure CID 91218366

MW:
262.300
g/mol
MF:
C14H18N2O3
IUPAC name:
ethane;5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2015-03-17
13.
an image of a chemical structure CID 68656914

SCHEMBL3475428

MW:
271.330
g/mol
MF:
C12H12KN2O3
Create Date:
2012-11-30
14.
an image of a chemical structure CID 66662982

SCHEMBL352763

MW:
272.310
g/mol
MF:
C12H12CaN2O3
Create Date:
2012-11-30
15.
an image of a chemical structure CID 66587106

SCHEMBL42038

MW:
255.220
g/mol
MF:
C12H12N2NaO3
Create Date:
2012-11-30
16.
an image of a chemical structure CID 45262838

PHENOBARBITAL HYDROCHLORIDE; CHEMBL545356; SCHEMBL2120028

MW:
268.690
g/mol
MF:
C12H13ClN2O3
IUPAC name:
5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;hydrochloride
Create Date:
2010-05-07
17.
an image of a chemical structure CID 23716064

5-(2-Methylallyl)-5-phenylbarbituric acid sodium salt; BARBITURIC ACID, 5-(2-METHYLALLYL)-5-PHENYL-, SODIUM SALT

MW:
280.250
g/mol
MF:
C14H13N2NaO3
IUPAC name:
sodium;5-(2-methylprop-2-enyl)-5-phenylpyrimidin-3-ide-2,4,6...
Create Date:
2008-02-05
18.
an image of a chemical structure CID 23715960

5-Phenyl-5-propylbarbituric acid sodium salt; BARBITURIC ACID, 5-PHENYL-5-PROPYL-, SODIUM SALT

MW:
268.240
g/mol
MF:
C13H13N2NaO3
IUPAC name:
sodium;5-phenyl-5-propylpyrimidin-3-ide-2,4,6-trione
Create Date:
2008-02-05
19.
an image of a chemical structure CID 12598276

UNII-SW9M9BB5K3; SW9M9BB5K3; CHEBI:8070 ...

MW:
254.220
g/mol
MF:
C12H11N2NaO3
IUPAC name:
sodium;5-ethyl-5-phenylpyrimidin-3-ide-2,4,6-trione
Create Date:
2007-02-08
20.
an image of a chemical structure CID 49333

5-(3-Methyl-2-butenyl)-5-phenylbarbituric acid; BARBITURIC ACID, 5-(3-METHYL-2-BUTENYL)-5-PHENYL-; 67051-62-1 ...

MW:
272.300
g/mol
MF:
C15H16N2O3
IUPAC name:
5-(3-methylbut-2-enyl)-5-phenyl-1,3-diazinane-2,4,6-trione
Create Date:
2005-08-08
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center