Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 167

1.
an image of a chemical structure CID 5283389

N-arachidonylglycine; N-arachidonoylglycine; NAGly ...

MW:
361.500
g/mol
MF:
C22H35NO3
IUPAC name:
2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]acetic ...
Create Date:
2006-01-13
2.
an image of a chemical structure CID 5353806

SCHEMBL158051; CHEBI:92898; AKOS015911282 ...

MW:
361.500
g/mol
MF:
C22H35NO3
IUPAC name:
2-[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]amino]acetic ...
Create Date:
2005-03-25
3.
an image of a chemical structure CID 4345

2-(1-oxoeicosa-5,8,11,14-tetraenylamino)acetic acid; Bio1_000014; CBiol_001728 ...

MW:
361.500
g/mol
MF:
C22H35NO3
IUPAC name:
2-(icosa-5,8,11,14-tetraenoylamino)acetic acid
Create Date:
2005-03-25
4.
an image of a chemical structure CID 90960783

MW:
369.600
g/mol
MF:
C22H35NO3
IUPAC name:
deuterio 2,2-dideuterio-2-[deuterio(2,2,3,3-tetradeuterioico...
Create Date:
2015-03-17
5.
an image of a chemical structure CID 53394532

2-(5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoylamino)acetic acid

MW:
369.600
g/mol
MF:
C22H35NO3
IUPAC name:
2-(5,6,8,9,11,12,14,15-octadeuterioicosa-5,8,11,14-tetraenoy...
Create Date:
2011-10-30
6.
an image of a chemical structure CID 130292055

SCHEMBL19199576

MW:
373.500
g/mol
MF:
C23H35NO3
IUPAC name:
2-[[(6Z,9Z,12Z,15Z,18Z)-henicosa-6,9,12,15,18-pentaenoyl]ami...
Create Date:
2017-10-07
7.
an image of a chemical structure CID 117764076

SCHEMBL16324338

MW:
359.500
g/mol
MF:
C22H33NO3
IUPAC name:
2-[[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]amino]...
Create Date:
2016-02-23
8.
an image of a chemical structure CID 117763715

SCHEMBL16323891

MW:
359.500
g/mol
MF:
C22H33NO3
IUPAC name:
2-[[(5Z,8Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]acetic a...
Create Date:
2016-02-23
9.
an image of a chemical structure CID 73035929

MW:
359.500
g/mol
MF:
C22H33NO3
IUPAC name:
2-(icosa-5,8,11,14,17-pentaenoylamino)acetic acid
Create Date:
2014-03-07
10.
an image of a chemical structure CID 73006864

MW:
335.500
g/mol
MF:
C20H33NO3
IUPAC name:
2-(octadeca-6,9,12-trienoylamino)acetic acid
Create Date:
2014-03-06
11.
an image of a chemical structure CID 11631845

SCHEMBL13745070; 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]acetic Acid; NCGC00161205-02

MW:
359.500
g/mol
MF:
C22H33NO3
IUPAC name:
2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]...
Create Date:
2006-10-26
12.
an image of a chemical structure CID 11559087

gamma-Linolenoyl glycine; CHEMBL225746; SCHEMBL13745324 ...

MW:
335.500
g/mol
MF:
C20H33NO3
IUPAC name:
2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]acetic acid
Create Date:
2006-10-26
13.
an image of a chemical structure CID 135239992

SCHEMBL20398921; C(CCC\C=C/CCCCCCCCCC)(=O)NCC(=O)O

MW:
311.500
g/mol
MF:
C18H33NO3
IUPAC name:
2-[[(Z)-hexadec-5-enoyl]amino]acetic acid
Create Date:
2018-12-15
14.
an image of a chemical structure CID 118906407

SCHEMBL17545514; ZINC299817126; 2-(6Z,9Z,12Z,15Z)-octadeca-tetraenamidoaceticacid

MW:
333.500
g/mol
MF:
C20H31NO3
IUPAC name:
2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]acet...
Create Date:
2016-04-09
15.
an image of a chemical structure CID 40486877

N-arachidonoylglycinate; N-(5Z,8Z,11Z,14Z)-eicosatetraenoyl-glycine; CHEBI:59002 ...

MW:
360.500
g/mol
MF:
C22H34NO3-
IUPAC name:
2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]acetate
Create Date:
2009-05-30
16.
an image of a chemical structure CID 141141922

MW:
376.600
g/mol
MF:
C23H37NO3
IUPAC name:
(2S)-2-[[(5Z,8Z,11Z,14Z)-20-deuterioicosa-5,8,11,14-tetraeno...
Create Date:
2019-12-06
17.
an image of a chemical structure CID 135240005

SCHEMBL20398940; C(CCCC\C=C/CCCCCCCCCCC)(=O)NCC(=O)O

MW:
339.500
g/mol
MF:
C20H37NO3
IUPAC name:
2-[[(Z)-octadec-6-enoyl]amino]acetic acid
Create Date:
2018-12-15
18.
an image of a chemical structure CID 130374700

SCHEMBL19293348

MW:
387.600
g/mol
MF:
C24H37NO3
IUPAC name:
2-[[(6Z,9Z,12Z,15Z,18Z)-20-methylhenicosa-6,9,12,15,18-penta...
Create Date:
2017-10-07
19.
an image of a chemical structure CID 91535330

MW:
375.500
g/mol
MF:
C23H37NO3
IUPAC name:
(2R)-2-(icosa-5,8,11,14-tetraenoylamino)propanoic acid
Create Date:
2015-03-17
20.
an image of a chemical structure CID 87565353

SCHEMBL3728695; ZINC98044297

MW:
375.500
g/mol
MF:
C23H37NO3
IUPAC name:
(2S)-2-[[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]amino]pr...
Create Date:
2015-02-12
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center