Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 82

1.
an image of a chemical structure CID 5694

Pirinixic acid; 50892-23-4; WY-14643 ...

MW:
323.800
g/mol
MF:
C14H14ClN3O2S
IUPAC name:
2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylac...
Create Date:
2004-09-16
2.
an image of a chemical structure CID 147552597

MW:
449.700
g/mol
MF:
C14H13ClIN3O2S
IUPAC name:
2-[4-chloro-6-[2-(iodomethyl)-3-methylanilino]pyrimidin-2-yl...
Create Date:
2020-08-12
3.
an image of a chemical structure CID 88011571

SCHEMBL6563348

MW:
345.800
g/mol
MF:
C14H13ClN3NaO2S
IUPAC name:
sodium;2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sul...
Create Date:
2015-02-12
4.
an image of a chemical structure CID 11978565

CHEMBL454691; BDBM50253802; 2-(4-chloro-6-(2,3-dimethylphenylamino)pyrimidin-2-ylthio)propanoic acid ...

MW:
337.800
g/mol
MF:
C15H16ClN3O2S
IUPAC name:
2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylpr...
Create Date:
2007-01-03
5.
an image of a chemical structure CID 155556924

CHEMBL4556277; BDBM50530354

MW:
337.800
g/mol
MF:
C15H16ClN3O2S
IUPAC name:
3-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylpr...
Create Date:
2021-02-17
6.
an image of a chemical structure CID 155539254

CHEMBL4514313; BDBM50530347

MW:
309.770
g/mol
MF:
C13H12ClN3O2S
IUPAC name:
2-[4-chloro-6-(3-methylanilino)pyrimidin-2-yl]sulfanylacetic...
Create Date:
2021-02-17
7.
an image of a chemical structure CID 155534885

CHEMBL4471255; BDBM50530341

MW:
309.770
g/mol
MF:
C13H12ClN3O2S
IUPAC name:
2-[4-chloro-6-(2-methylanilino)pyrimidin-2-yl]sulfanylacetic...
Create Date:
2021-02-17
8.
an image of a chemical structure CID 24828806

CHEMBL459521; BDBM24555; Pirinixic acid-based compound, 2g ...

MW:
335.800
g/mol
MF:
C15H14ClN3O2S
IUPAC name:
2-[4-chloro-6-(2,3-dihydro-1H-inden-4-ylamino)pyrimidin-2-yl...
Create Date:
2008-07-07
9.
an image of a chemical structure CID 11978570

CHEMBL512563; BDBM50273680; 2-(4-chloro-6-(2,3-dimethylphenylamino)pyrimidin-2-ylthio)-2-methylpropanoic acid ...

MW:
351.900
g/mol
MF:
C16H18ClN3O2S
IUPAC name:
2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanyl-2...
Create Date:
2007-01-03
10.
an image of a chemical structure CID 155560868

CHEMBL4575123; BDBM50530346

MW:
349.800
g/mol
MF:
C16H16ClN3O2S
IUPAC name:
2-[4-chloro-6-(5,6,7,8-tetrahydronaphthalen-1-ylamino)pyrimi...
Create Date:
2021-02-17
11.
an image of a chemical structure CID 150277267

MW:
355.800
g/mol
MF:
C14H14ClN3O4S
IUPAC name:
2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfonylac...
Create Date:
2020-08-12
12.
an image of a chemical structure CID 123326453

MW:
307.800
g/mol
MF:
C14H14ClN3OS
IUPAC name:
S-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl] ethanethi...
Create Date:
2017-01-24
13.
an image of a chemical structure CID 13413729

CHEMBL44078; SCHEMBL7084954; BDBM50530355

MW:
337.800
g/mol
MF:
C15H16ClN3O2S
IUPAC name:
2-[4-chloro-6-(N,2,3-trimethylanilino)pyrimidin-2-yl]sulfany...
Create Date:
2007-02-08
14.
an image of a chemical structure CID 11978566

CHEMBL4536821; BDBM50530348; 2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylbutanoic acid

MW:
351.900
g/mol
MF:
C16H18ClN3O2S
IUPAC name:
2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylbu...
Create Date:
2007-01-03
15.
an image of a chemical structure CID 9798569

CHEMBL500368; SCHEMBL6565495; [4-chloro-6-(2,3-xylidino)-2-pyrimidinylthio] acetic acid, ethyl ester ...

MW:
351.900
g/mol
MF:
C16H18ClN3O2S
IUPAC name:
ethyl 2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulf...
Create Date:
2006-10-25
16.
an image of a chemical structure CID 153763215

ClC1=NC(=NC(=C1)NC=1C=C2CCCC2=CC=1)SCC(=O)O

MW:
335.800
g/mol
MF:
C15H14ClN3O2S
IUPAC name:
2-[4-chloro-6-(2,3-dihydro-1H-inden-5-ylamino)pyrimidin-2-yl...
Create Date:
2020-08-14
17.
an image of a chemical structure CID 44569220

CHEMBL453175

MW:
365.900
g/mol
MF:
C17H20ClN3O2S
IUPAC name:
ethyl 2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulf...
Create Date:
2010-01-26
18.
an image of a chemical structure CID 24828805

CHEMBL4443400; BDBM50530351; 2-[4-chloro-6-(4-chloro-2,3-dimethylanilino)pyrimidin-2-yl]sulfanylacetic acid

MW:
358.200
g/mol
MF:
C14H13Cl2N3O2S
IUPAC name:
2-[4-chloro-6-(4-chloro-2,3-dimethylanilino)pyrimidin-2-yl]s...
Create Date:
2008-07-07
19.
an image of a chemical structure CID 21557341

SCHEMBL11833234; [4-Chloro-6-(2,3-xylidino)-2-pyrimidinylthio]acetamide; 2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylacetamide

MW:
322.800
g/mol
MF:
C14H15ClN4OS
IUPAC name:
2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylac...
Create Date:
2007-12-05
20.
an image of a chemical structure CID 11978571

2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanyl-2-methylbutanoic acid

MW:
365.900
g/mol
MF:
C17H20ClN3O2S
IUPAC name:
2-[4-chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanyl-2...
Create Date:
2007-01-03
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center