Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 11

1.
2.
an image of a chemical structure CID 13767014

Carbon-13C tetrachloride; 32488-50-9; tetrachloro(113C)methane ...

MW:
154.800
g/mol
MF:
CCl4
IUPAC name:
tetrachloro(113C)methane
Create Date:
2007-02-08
3.
an image of a chemical structure CID 154317492

Cl[ClH](C(Cl)(Cl)Cl)(Cl)Cl

MW:
260.200
g/mol
MF:
CCl7-
Create Date:
2020-08-14
4.
an image of a chemical structure CID 154145246

ClCl(C(Cl)(Cl)Cl)Cl

MW:
224.700
g/mol
MF:
CCl6
IUPAC name:
dichloro(trichloromethyl)-lambda3-chlorane
Create Date:
2020-08-14
5.
an image of a chemical structure CID 153745346

Cl[ClH]C(Cl)(Cl)Cl

MW:
189.300
g/mol
MF:
CCl5-
IUPAC name:
trichloro(chlorochloranuidyl)methane
Create Date:
2020-08-14
6.
an image of a chemical structure CID 149826642

MW:
154.800
g/mol
MF:
CHCl4+
IUPAC name:
trichloromethylchloranium
Create Date:
2020-08-12
7.
an image of a chemical structure CID 139954008

tetrachloride dihydrochloride

MW:
226.700
g/mol
MF:
CH2Cl6
IUPAC name:
tetrachloromethane;dihydrochloride
Create Date:
2019-12-06
8.
an image of a chemical structure CID 129764339

dichloro-methylene chlorine

MW:
153.800
g/mol
MF:
CCl4
IUPAC name:
chloro(dichloromethylidene)-lambda3-chlorane
Create Date:
2017-09-13
9.
an image of a chemical structure CID 86737392

Cl2 CCl4; chlorine tetrachloromethane; chlorine carbon tetrachloride

MW:
224.700
g/mol
MF:
CCl6
IUPAC name:
molecular chlorine;tetrachloromethane
Create Date:
2015-02-02
10.
an image of a chemical structure CID 22943909

MW:
153.800
g/mol
MF:
CCl4
IUPAC name:
chloro-[(chloro-lambda3-chloranylidene)methylidene]-lambda3-...
Create Date:
2007-12-05
11.
an image of a chemical structure CID 20487750

SCHEMBL1406167; Chlorwasserstoff Tetrachlorkohlenstoff

MW:
190.300
g/mol
MF:
CHCl5
IUPAC name:
tetrachloromethane;hydrochloride
Create Date:
2007-12-05
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center