Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 63

1.
2.
an image of a chemical structure CID 151659277

MW:
70.058
g/mol
MF:
C2H3N3
IUPAC name:
(513C)2H-triazole
Create Date:
2020-08-13
3.
an image of a chemical structure CID 138396079

DTXSID90892734; (2-~2~H)-2H-1,2,3-Triazole

MW:
70.070
g/mol
MF:
C2H3N3
IUPAC name:
2-deuteriotriazole
Create Date:
2019-06-20
4.
an image of a chemical structure CID 141621038

N(=[N+]=[N-])[N+]=1NN=CC=1

MW:
111.090
g/mol
MF:
C2H3N6+
IUPAC name:
1-azido-2H-triazol-1-ium
Create Date:
2019-12-06
5.
an image of a chemical structure CID 90788551

triazol-1-ylazanide

MW:
83.070
g/mol
MF:
C2H3N4-
IUPAC name:
triazol-1-ylazanide
Create Date:
2015-03-16
6.
an image of a chemical structure CID 69337660

SCHEMBL5165298

MW:
132.610
g/mol
MF:
C2H3CuN3
IUPAC name:
copper;2H-triazole
Create Date:
2012-12-01
7.
8.
9.
an image of a chemical structure CID 22613062

MW:
148.970
g/mol
MF:
C2H3BrN3-
IUPAC name:
2H-triazole;bromide
Create Date:
2007-12-05
10.
an image of a chemical structure CID 151794025

MW:
125.090
g/mol
MF:
C2H3N7
IUPAC name:
N-azidotriazol-2-amine
Create Date:
2020-08-13
11.
an image of a chemical structure CID 150809767

MW:
88.060
g/mol
MF:
C2H3FN3+
IUPAC name:
1-fluoro-2H-triazol-1-ium
Create Date:
2020-08-13
12.
an image of a chemical structure CID 141056755

MW:
228.870
g/mol
MF:
C2H3Br2N3
IUPAC name:
molecular bromine;2H-triazole
Create Date:
2019-12-06
13.
an image of a chemical structure CID 135024122

MW:
79.880
g/mol
MF:
C2H3BN3
Create Date:
2018-11-30
14.
an image of a chemical structure CID 129739498

1H-triazol-1-ium-1-amine; 3-Amino-1H-1,2,3-triazole-3-ium

MW:
85.090
g/mol
MF:
C2H5N4+
IUPAC name:
2H-triazol-1-ium-1-amine
Create Date:
2017-09-13
15.
an image of a chemical structure CID 118092379

SCHEMBL16737070

MW:
103.150
g/mol
MF:
C2H5N3S
IUPAC name:
sulfane;2H-triazole
Create Date:
2016-02-23
16.
an image of a chemical structure CID 87705263

stannyltriazole; [SnH3]C1=CNN=N1; SCHEMBL4637851

MW:
186.770
g/mol
MF:
C2H2N3Sn
Create Date:
2015-02-12
17.
an image of a chemical structure CID 66801332

SCHEMBL792269

MW:
149.980
g/mol
MF:
C2H4BrN3
IUPAC name:
2H-triazole;hydrobromide
Create Date:
2012-11-30
18.
an image of a chemical structure CID 57192269

MW:
83.070
g/mol
MF:
C2H3N4+
Create Date:
2012-06-14
19.
an image of a chemical structure CID 22133982

triazole hydrochloride; SCHEMBL725323

MW:
105.530
g/mol
MF:
C2H4ClN3
IUPAC name:
2H-triazole;hydrochloride
Create Date:
2007-12-05
20.
an image of a chemical structure CID 14438034

1,3-Diamino-1H-1,2,3-triazole-3-ium

MW:
100.100
g/mol
MF:
C2H6N5+
IUPAC name:
triazol-1-ium-1,3-diamine
Create Date:
2007-02-09
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center