Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 135

1.
an image of a chemical structure CID 68740

Zoledronic acid; 118072-93-8; Zoledronate ...

MW:
272.090
g/mol
MF:
C5H10N2O7P2
IUPAC name:
(1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)phosphonic acid
Create Date:
2005-03-26
2.
an image of a chemical structure CID 25235936

MW:
274.100
g/mol
MF:
C5H10N2O7P2
IUPAC name:
(2,2-dideuterio-1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)p...
Create Date:
2009-05-04
3.
an image of a chemical structure CID 25207780

1134798-26-7; AKOS025311240; [1-Hydroxy-1-phosphono-2-(2,4,5-trideuterioimidazol-1-yl)ethyl]phosphonic acid

MW:
275.110
g/mol
MF:
C5H10N2O7P2
IUPAC name:
[1-hydroxy-1-phosphono-2-(2,4,5-trideuterioimidazol-1-yl)eth...
Create Date:
2009-04-06
4.
an image of a chemical structure CID 152745532

MW:
271.080
g/mol
MF:
C5H9N2O7P2-
IUPAC name:
hydroxy-(1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)phosphin...
Create Date:
2020-08-13
5.
an image of a chemical structure CID 149270828

MW:
273.100
g/mol
MF:
C5H11N2O7P2+
IUPAC name:
[hydroxy-(1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)phospho...
Create Date:
2020-08-12
6.
an image of a chemical structure CID 123230560

MW:
256.090
g/mol
MF:
C5H10N2O6P2
IUPAC name:
(1-dihydroxyphosphanyl-1-hydroxy-2-imidazol-1-ylethyl)phosph...
Create Date:
2017-01-24
7.
an image of a chemical structure CID 88851945

SCHEMBL11904960; O=P(=O)C(P(O)(O)=O)(O)CN1C=CN=C1

MW:
254.070
g/mol
MF:
C5H8N2O6P2
Create Date:
2015-02-13
8.
an image of a chemical structure CID 25201417

MW:
270.070
g/mol
MF:
C5H8N2O7P2-2
IUPAC name:
hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]-2-imidazol-1...
Create Date:
2009-03-31
9.
an image of a chemical structure CID 147904244

MW:
240.090
g/mol
MF:
C5H10N2O5P2
IUPAC name:
(1-hydroxy-1-hydroxyphosphanyl-2-imidazol-1-ylethyl)phosphon...
Create Date:
2020-08-12
10.
an image of a chemical structure CID 132146990

SCHEMBL19619067

MW:
270.120
g/mol
MF:
C6H12N2O6P2
IUPAC name:
[1-[dihydroxy(methylidene)-lambda5-phosphanyl]-1-hydroxy-2-i...
Create Date:
2018-01-29
11.
an image of a chemical structure CID 131732543

zoledronate phosphate

MW:
367.060
g/mol
MF:
C5H10N2O11P3-3
IUPAC name:
(1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)phosphonic acid;...
Create Date:
2017-11-15
12.
an image of a chemical structure CID 121350804

SCHEMBL17768347

MW:
285.110
g/mol
MF:
C6H11N2O7P2-
IUPAC name:
hydroxy-[1-hydroxy-1-[hydroxy(oxido)phosphoryl]-2-(3-methyli...
Create Date:
2016-08-06
13.
an image of a chemical structure CID 87207059

SCHEMBL1160616

MW:
312.170
g/mol
MF:
C5H10CaN2O7P2
Create Date:
2015-02-12
14.
an image of a chemical structure CID 71625850

SCHEMBL17768358

MW:
301.150
g/mol
MF:
C7H15N2O7P2+
IUPAC name:
[2-(3-ethylimidazol-1-ium-1-yl)-1-hydroxy-1-phosphonoethyl]p...
Create Date:
2013-08-05
15.
an image of a chemical structure CID 71625849

CHEMBL2338354; SCHEMBL22340134; BDBM50428290

MW:
300.140
g/mol
MF:
C7H14N2O7P2
IUPAC name:
[2-(3-ethylimidazol-1-ium-1-yl)-1-hydroxy-1-phosphonoethyl]-...
Create Date:
2013-08-05
16.
an image of a chemical structure CID 71625848

CHEMBL2338353; BDBM50428289

MW:
286.120
g/mol
MF:
C6H12N2O7P2
IUPAC name:
hydroxy-[1-hydroxy-2-(3-methylimidazol-3-ium-1-yl)-1-phospho...
Create Date:
2013-08-05
17.
an image of a chemical structure CID 18771155

3ldw; 2e91; 2-imidazol-1-yl-1,1-diphosphonatoethanol

MW:
268.060
g/mol
MF:
C5H6N2O7P2-4
IUPAC name:
2-imidazol-1-yl-1,1-diphosphonatoethanol
Create Date:
2007-12-04
18.
an image of a chemical structure CID 10379282

SCHEMBL17768317

MW:
287.120
g/mol
MF:
C6H13N2O7P2+
IUPAC name:
[1-hydroxy-2-(3-methylimidazol-3-ium-1-yl)-1-phosphonoethyl]...
Create Date:
2006-10-25
19.
an image of a chemical structure CID 121586

Zoledronic acid hydrate; 165800-06-6; Zoledronic acid monohydrate ...

MW:
290.110
g/mol
MF:
C5H12N2O8P2
IUPAC name:
(1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)phosphonic acid;...
Create Date:
2005-06-24
20.
an image of a chemical structure CID 141395112

MW:
312.090
g/mol
MF:
C5H11N2NaO8P2
IUPAC name:
sodium;hydroxy-(1-hydroxy-2-imidazol-1-yl-1-phosphonoethyl)p...
Create Date:
2019-12-06
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center