Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 144

1.
an image of a chemical structure CID 72734297

10,11-Epoxy-3-geranylgeranylindole; C20526; 3-[(2E,6E,10S,11S)-3,7,11,15-Tetramethyl-10,11-epoxy-2,6,14-hexadecatriene-1-yl]-1H-indole

MW:
405.600
g/mol
MF:
C28H39NO
IUPAC name:
3-[(2E,6E)-3,7-dimethyl-9-[(2S,3S)-3-methyl-3-(4-methylpent-...
Create Date:
2014-02-14
2.
an image of a chemical structure CID 101534501

3-(14,15-Epoxygeranylgeranyl)indole

MW:
405.600
g/mol
MF:
C28H39NO
IUPAC name:
3-[(2E,6E,10E)-13-[(2R)-3,3-dimethyloxiran-2-yl]-3,7,11-trim...
Create Date:
2015-12-18
3.
an image of a chemical structure CID 12067328

3-(omega-oxidogeranylgeranyl)indole; 3-[(2E,6E,10E)-3,7,11-Trimethyl-13-(3,3-dimethyloxirane-2beta-yl)-2,6,10-tridecatrienyl]-1H-indole

MW:
405.600
g/mol
MF:
C28H39NO
IUPAC name:
3-[(2E,6E,10E)-13-[(2S)-3,3-dimethyloxiran-2-yl]-3,7,11-trim...
Create Date:
2007-02-07
4.
an image of a chemical structure CID 101534502

3-(6,7-Epoxygeranyl)indole

MW:
269.400
g/mol
MF:
C18H23NO
IUPAC name:
3-[(E)-5-[(2S)-3,3-dimethyloxiran-2-yl]-3-methylpent-2-enyl]...
Create Date:
2015-12-18
5.
an image of a chemical structure CID 101534500

3-(10,11-Epoxyfarnesyl)indole

MW:
337.500
g/mol
MF:
C23H31NO
IUPAC name:
3-[(2E,6E)-9-[(2S)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona...
Create Date:
2015-12-18
6.
an image of a chemical structure CID 85292216

MW:
337.500
g/mol
MF:
C23H31NO
IUPAC name:
3-[9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienyl]-...
Create Date:
2014-10-23
7.
an image of a chemical structure CID 154401018

COCCCCCCCCCCC1=CNC2=CC=CC=C12

MW:
287.400
g/mol
MF:
C19H29NO
IUPAC name:
3-(10-methoxydecyl)-1H-indole
Create Date:
2020-08-14
8.
an image of a chemical structure CID 153195788

MW:
229.320
g/mol
MF:
C15H19NO
IUPAC name:
3-[(4R)-4-methoxy-2-methylidenepentyl]-1H-indole
Create Date:
2020-08-13
9.
an image of a chemical structure CID 141967226

MW:
341.500
g/mol
MF:
C23H35NO
IUPAC name:
3-(4-butan-2-yl-4-propoxycyclohexen-1-yl)-1H-indole;ethane
Create Date:
2019-12-06
10.
an image of a chemical structure CID 70448909

SCHEMBL10810969

MW:
413.700
g/mol
MF:
C28H47NO
IUPAC name:
(2R,3S)-3-heptyl-2-octyloxane;1H-indole
Create Date:
2012-12-01
11.
an image of a chemical structure CID 155473366

SCHEMBL22879508

MW:
243.340
g/mol
MF:
C16H21NO
IUPAC name:
3-(3-methyl-3-prop-2-enoxybutyl)-1H-indole
Create Date:
2021-01-30
12.
an image of a chemical structure CID 91801517

MW:
203.280
g/mol
MF:
C13H17NO
IUPAC name:
3-(4-methoxybutyl)-1H-indole
Create Date:
2015-06-24
13.
14.
an image of a chemical structure CID 146958604

SCHEMBL22702122

MW:
216.280
g/mol
MF:
C13H16N2O
IUPAC name:
N-[2-(1H-indol-3-yl)ethyl]-3-methyloxiran-2-amine
Create Date:
2020-08-12
15.
an image of a chemical structure CID 141967155

MW:
329.500
g/mol
MF:
C21H28FNO
IUPAC name:
3-(4-butan-2-yl-4-propoxycyclohexen-1-yl)-5-fluoro-1H-indole
Create Date:
2019-12-06
16.
an image of a chemical structure CID 138526480

SCHEMBL20879325

MW:
327.500
g/mol
MF:
C22H33NO
IUPAC name:
3-[3-(2,6-dimethyloctan-2-yloxy)but-3-enyl]-1H-indole
Create Date:
2019-07-20
17.
an image of a chemical structure CID 132159291

SCHEMBL19632858

MW:
203.280
g/mol
MF:
C13H17NO
IUPAC name:
3-(2-ethoxypropyl)-1H-indole
Create Date:
2018-01-29
18.
an image of a chemical structure CID 131965208

SCHEMBL19412094

MW:
258.360
g/mol
MF:
C16H22N2O
IUPAC name:
N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]oxan-4-amine
Create Date:
2018-01-29
19.
an image of a chemical structure CID 131965187

SCHEMBL19412077; N1C=C(C2=CC=CC=C12)CC(C)NC1CCOCC1

MW:
258.360
g/mol
MF:
C16H22N2O
IUPAC name:
N-[1-(1H-indol-3-yl)propan-2-yl]oxan-4-amine
Create Date:
2018-01-29
20.
an image of a chemical structure CID 101523323

3-[2-Methyl-5-(1-methoxy-1-methylethyl)-1-cyclopentenylmethyl]-1H-indole

MW:
283.400
g/mol
MF:
C19H25NO
IUPAC name:
3-[[5-(2-methoxypropan-2-yl)-2-methylcyclopenten-1-yl]methyl...
Create Date:
2015-12-18
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center