Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 665

1.
an image of a chemical structure CID 136100055

SCHEMBL12606227

MW:
260.210
g/mol
MF:
C11H8N4O4
IUPAC name:
1H-pyrimido[5,4-c][5,7,1,2]benzodioxadiazonine-2,4-dione
Create Date:
2019-01-21
2.
an image of a chemical structure CID 135161709

SCHEMBL20310593

MW:
253.360
g/mol
MF:
C13H19NO2S
IUPAC name:
2-(cyclohex-2-en-1-ylmethyl)-2,5-dimethyl-1-oxo-4H-1,4-thiaz...
Create Date:
2018-12-15
3.
an image of a chemical structure CID 135044607

MW:
246.260
g/mol
MF:
C13H14N2O3
IUPAC name:
1-methyl-5-[(3-methylphenyl)methyl]-1,3-diazinane-2,4,6-trio...
Create Date:
2018-11-30
4.
an image of a chemical structure CID 135033533

MW:
236.200
g/mol
MF:
C11H9FN2O3
IUPAC name:
5-[(2-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione
Create Date:
2018-11-30
5.
an image of a chemical structure CID 135033269

MW:
266.680
g/mol
MF:
C12H11ClN2O3
IUPAC name:
5-[(4-chlorophenyl)methyl]-1-methyl-1,3-diazinane-2,4,6-trio...
Create Date:
2018-11-30
6.
an image of a chemical structure CID 135003387

MW:
224.300
g/mol
MF:
C11H13FN2S
IUPAC name:
(4R,5R)-5-(4-fluorophenyl)-4-methyl-1,3-diazinane-2-thione
Create Date:
2018-11-30
7.
an image of a chemical structure CID 133065041

CN1CC2(C(C1)C1=CC=CC=C1)C(NC(NC2=O)=O)=O; 2-methyl-4-phenyl-2,7,9-triazaspiro[4.5]decane-6,8,10-trione

MW:
273.290
g/mol
MF:
C14H15N3O3
IUPAC name:
2-methyl-4-phenyl-2,7,9-triazaspiro[4.5]decane-6,8,10-trione
Create Date:
2018-05-04
8.
an image of a chemical structure CID 130007392

SCHEMBL22623628

MW:
207.250
g/mol
MF:
C10H9NO2S
IUPAC name:
2-phenylthiomorpholine-3,5-dione
Create Date:
2017-10-07
9.
an image of a chemical structure CID 124303166

SCHEMBL21119237; ZINC3634839; UNII-55J7J6T77W component JJRVMNNZSIOQLB-CYBMUJFWSA-N

MW:
215.250
g/mol
MF:
C13H13NO2
IUPAC name:
(3R)-3-ethyl-3-phenylpyridine-2,6-dione
Create Date:
2017-04-10
10.
an image of a chemical structure CID 123333512

MW:
222.280
g/mol
MF:
C12H18N2O2
IUPAC name:
1-(2-cyclopentylethyl)-5-methylpyrimidine-2,4-dione
Create Date:
2017-01-24
11.
an image of a chemical structure CID 123303446

MW:
230.240
g/mol
MF:
C10H15FN2O3
IUPAC name:
5-ethyl-5-(4-fluorobutan-2-yl)-1,3-diazinane-2,4,6-trione
Create Date:
2017-01-24
12.
an image of a chemical structure CID 123260637

MW:
222.220
g/mol
MF:
C11H11FN2O2
IUPAC name:
5-(2-fluorophenyl)-1,5-dimethylimidazolidine-2,4-dione
Create Date:
2017-01-24
13.
an image of a chemical structure CID 123256533

MW:
234.320
g/mol
MF:
C12H14N2OS
IUPAC name:
1-(4-methylphenyl)-2-sulfanylidene-1,3-diazepan-4-one
Create Date:
2017-01-24
14.
an image of a chemical structure CID 122460049

SCHEMBL17983894; N1C(NC2(C1=O)C1=C(SC2)C=CC=C1)=O

MW:
220.250
g/mol
MF:
C10H8N2O2S
IUPAC name:
spiro[2H-1-benzothiophene-3,5'-imidazolidine]-2',4'-dione
Create Date:
2016-12-08
15.
an image of a chemical structure CID 122189435

CHEMBL3613952; 1-Phenethyl-5-hydroxy-pyrimidine-2(1H),4(3H)-dione

MW:
232.230
g/mol
MF:
C12H12N2O3
IUPAC name:
5-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione
Create Date:
2016-10-26
16.
an image of a chemical structure CID 122177109

5LM

MW:
284.400
g/mol
MF:
C11H12N2O3S2
IUPAC name:
5-[(1R)-1-sulfanyl-3-thiophen-2-ylpropyl]-1,3-diazinane-2,4,...
Create Date:
2016-10-21
17.
an image of a chemical structure CID 122177108

5LL

MW:
268.290
g/mol
MF:
C11H12N2O4S
IUPAC name:
5-[(1R)-3-(furan-2-yl)-1-sulfanylpropyl]-1,3-diazinane-2,4,6...
Create Date:
2016-10-21
18.
an image of a chemical structure CID 121477202

SCHEMBL17917605

MW:
254.190
g/mol
MF:
C11H8F2N2O3
IUPAC name:
5-[(3,4-difluorophenyl)methyl]-1,3-diazinane-2,4,6-trione
Create Date:
2016-08-06
19.
an image of a chemical structure CID 121408698

SCHEMBL17837020; C1(CCCCC1)C1(C(NC(NC1=O)=O)=O)CCC

MW:
252.310
g/mol
MF:
C13H20N2O3
IUPAC name:
5-cyclohexyl-5-propyl-1,3-diazinane-2,4,6-trione
Create Date:
2016-08-06
20.
an image of a chemical structure CID 121231502

5-ethyl-5-(pent-4-yn-1-yl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione

MW:
238.310
g/mol
MF:
C11H14N2O2S
IUPAC name:
5-ethyl-5-pent-4-ynyl-2-sulfanylidene-1,3-diazinane-4,6-dion...
Create Date:
2016-07-26
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center