Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 137

1.
an image of a chemical structure CID 155388400

SCHEMBL22773894

MW:
232.280
g/mol
MF:
C13H16N2O2
IUPAC name:
1H-1,2-benzodiazepine;butanoic acid
Create Date:
2021-01-30
2.
an image of a chemical structure CID 155227672

SCHEMBL22578992

MW:
218.250
g/mol
MF:
C12H14N2O2
IUPAC name:
1H-1,2-benzodiazepine;propanoic acid
Create Date:
2020-12-19
3.
an image of a chemical structure CID 155145138

SCHEMBL22468813

MW:
223.270
g/mol
MF:
C14H13N3
IUPAC name:
1H-1,2-benzodiazepine;pyridine
Create Date:
2020-12-19
4.
an image of a chemical structure CID 154411636

[NH+]=1NC=CC=C2C=1C=CC=C2

MW:
145.180
g/mol
MF:
C9H9N2+
IUPAC name:
1H-1,2-benzodiazepin-2-ium
Create Date:
2020-08-14
5.
an image of a chemical structure CID 146635922

SCHEMBL22042109

MW:
263.340
g/mol
MF:
C17H17N3
IUPAC name:
1H-1,2-benzodiazepine;2,3-dihydro-1H-indole
Create Date:
2020-06-27
6.
an image of a chemical structure CID 137360713

SCHEMBL20586241

MW:
432.900
g/mol
MF:
C25H25ClN4O
IUPAC name:
1H-1,2-benzodiazepine;7-chloro-5-(cyclohexen-1-yl)-1-methyl-...
Create Date:
2019-03-16
7.
an image of a chemical structure CID 135563244

SCHEMBL8005812

MW:
615.200
g/mol
MF:
C36H35ClN8
IUPAC name:
1H-1,2-benzodiazepine;3-chloro-6-(4-methylpiperazin-1-yl)-11...
Create Date:
2019-01-15
8.
an image of a chemical structure CID 132142574

SCHEMBL19614118

MW:
401.500
g/mol
MF:
C26H31N3O
IUPAC name:
1H-1,2-benzodiazepine;(1R,9R,10R)-17-methyl-17-azatetracyclo...
Create Date:
2018-01-29
9.
an image of a chemical structure CID 131738469

Benzodiazepine Lactose

MW:
486.500
g/mol
MF:
C21H30N2O11
IUPAC name:
1H-1,2-benzodiazepine;(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[...
Create Date:
2017-11-15
10.
an image of a chemical structure CID 122538562

SCHEMBL18074943

MW:
217.270
g/mol
MF:
C11H15N5
IUPAC name:
1H-1,2-benzodiazepine;triazolidine
Create Date:
2016-12-08
11.
an image of a chemical structure CID 122538561

SCHEMBL18074941

MW:
245.320
g/mol
MF:
C14H19N3O
IUPAC name:
1H-1,2-benzodiazepine;oxazepane
Create Date:
2016-12-08
12.
an image of a chemical structure CID 122421243

SCHEMBL17938828

MW:
447.500
g/mol
MF:
C24H22FN5O3
IUPAC name:
1H-1,2-benzodiazepine;ethyl 8-fluoro-5-methyl-6-oxo-4H-imida...
Create Date:
2016-12-08
13.
an image of a chemical structure CID 121378071

SCHEMBL17800878

MW:
838.400
g/mol
MF:
C47H52ClN11O2
IUPAC name:
1H-1,2-benzodiazepine;8-chloro-1-methyl-6-phenyl-4H-[1,2,4]t...
Create Date:
2016-08-06
14.
an image of a chemical structure CID 118937477

SCHEMBL17581939

MW:
338.310
g/mol
MF:
C15H18N2O7
IUPAC name:
1H-1,2-benzodiazepine;(2S,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan...
Create Date:
2016-04-09
15.
an image of a chemical structure CID 118626777

SCHEMBL17396259

MW:
532.000
g/mol
MF:
C30H31ClFN5O
IUPAC name:
1H-1,2-benzodiazepine;7-chloro-1-[2-(diethylamino)ethyl]-5-(...
Create Date:
2016-02-23
16.
an image of a chemical structure CID 118626730

SCHEMBL17396210

MW:
496.900
g/mol
MF:
C26H20ClF3N4O
IUPAC name:
1H-1,2-benzodiazepine;7-chloro-5-phenyl-1-(2,2,2-trifluoroet...
Create Date:
2016-02-23
17.
an image of a chemical structure CID 118626666

SCHEMBL17396146

MW:
438.900
g/mol
MF:
C25H19ClN6
IUPAC name:
1H-1,2-benzodiazepine;8-chloro-6-phenyl-4H-[1,2,4]triazolo[4...
Create Date:
2016-02-23
18.
an image of a chemical structure CID 118485192

SCHEMBL17225092

MW:
460.300
g/mol
MF:
C23H18BrN5O
IUPAC name:
1H-1,2-benzodiazepine;7-bromo-5-pyridin-2-yl-1,3-dihydro-1,4...
Create Date:
2016-02-23
19.
an image of a chemical structure CID 118485189

SCHEMBL17225089

MW:
414.900
g/mol
MF:
C24H19ClN4O
IUPAC name:
1H-1,2-benzodiazepine;7-chloro-5-phenyl-1,3-dihydro-1,4-benz...
Create Date:
2016-02-23
20.
an image of a chemical structure CID 118431134

SCHEMBL17156980

MW:
479.400
g/mol
MF:
C25H20Cl2N4O2
IUPAC name:
1H-1,2-benzodiazepine;7-chloro-5-(2-chlorophenyl)-3-hydroxy-...
Create Date:
2016-02-23
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Support Center