Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 385

1.
an image of a chemical structure CID 155182998

SCHEMBL22518940

MW:
260.290
g/mol
MF:
C14H16N2O3
IUPAC name:
4-aminophenol;N-(4-hydroxyphenyl)acetamide
Create Date:
2020-12-19
2.
an image of a chemical structure CID 153899050

C(C)(=O)NC1=CC=C(O[Zr])C=C1

MW:
242.390
g/mol
MF:
C8H9NO2Zr
IUPAC name:
N-(4-hydroxyphenyl)acetamide;zirconium
Create Date:
2020-08-14
3.
an image of a chemical structure CID 153328786

MW:
505.600
g/mol
MF:
C26H35N9O2
IUPAC name:
N-(4-hydroxyphenyl)acetamide;methanimine;3-methyl-6-[[methyl...
Create Date:
2020-08-13
4.
an image of a chemical structure CID 145676293

MW:
167.200
g/mol
MF:
C9H13NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide;methane
Create Date:
2019-12-12
5.
an image of a chemical structure CID 145397607

MW:
494.000
g/mol
MF:
C25H24ClN5O2S
IUPAC name:
7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetraza...
Create Date:
2019-12-07
6.
an image of a chemical structure CID 144644119

MW:
452.600
g/mol
MF:
C24H40N2O6
IUPAC name:
(2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoic acid;e...
Create Date:
2019-12-07
7.
an image of a chemical structure CID 144644084

MW:
436.500
g/mol
MF:
C23H36N2O6
IUPAC name:
(2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoic acid;e...
Create Date:
2019-12-07
8.
an image of a chemical structure CID 144618563

MW:
422.500
g/mol
MF:
C22H34N2O6
IUPAC name:
(2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoic acid;e...
Create Date:
2019-12-07
9.
an image of a chemical structure CID 144618505

MW:
480.600
g/mol
MF:
C26H44N2O6
IUPAC name:
butane;(2S)-3-(3,4-dihydroxyphenyl)-2-(methylamino)propanoic...
Create Date:
2019-12-07
10.
an image of a chemical structure CID 144607898

MW:
182.220
g/mol
MF:
C9H14N2O2
IUPAC name:
N-(4-hydroxyphenyl)acetamide;methanamine
Create Date:
2019-12-07
11.
an image of a chemical structure CID 144564570

MW:
199.270
g/mol
MF:
C9H13NO2S
IUPAC name:
N-(4-hydroxyphenyl)acetamide;methanethiol
Create Date:
2019-12-07
12.
an image of a chemical structure CID 144003985

MW:
211.300
g/mol
MF:
C12H21NO2
IUPAC name:
ethane;N-(4-hydroxyphenyl)acetamide
Create Date:
2019-12-07
13.
an image of a chemical structure CID 142107926

MW:
348.300
g/mol
MF:
C17H20N2O6
IUPAC name:
N-(4-hydroxyphenyl)acetamide;3-(4-nitrophenyl)propane-1,2-di...
Create Date:
2019-12-06
14.
an image of a chemical structure CID 140999210

MW:
187.190
g/mol
MF:
C8H13NO4
IUPAC name:
N-(4-hydroxyphenyl)acetamide;dihydrate
Create Date:
2019-12-06
15.
an image of a chemical structure CID 139507894

SCHEMBL21378799

MW:
381.400
g/mol
MF:
C22H23NO5
IUPAC name:
N-(4-hydroxyphenyl)acetamide;(2S)-2-(6-methoxynaphthalen-2-y...
Create Date:
2019-11-02
16.
an image of a chemical structure CID 139348435

SCHEMBL21198644

MW:
628.200
g/mol
MF:
C37H42ClN3O4
IUPAC name:
4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-...
Create Date:
2019-11-02
17.
an image of a chemical structure CID 139205670

acetaminophen:methanol solvate; paracetamol:methanol solvate, (1:1)

MW:
549.600
g/mol
MF:
C27H39N3O9
IUPAC name:
N-(4-hydroxyphenyl)acetamide;methanol
Create Date:
2019-10-03
18.
an image of a chemical structure CID 139200747

Paracetamol pyridine solvate

MW:
381.400
g/mol
MF:
C21H23N3O4
IUPAC name:
N-(4-hydroxyphenyl)acetamide;pyridine
Create Date:
2019-10-03
19.
an image of a chemical structure CID 139197242

Acetaminophen hydrobromide monohydrate salt

MW:
250.090
g/mol
MF:
C8H12BrNO3
IUPAC name:
1-hydroxyethylidene-(4-hydroxyphenyl)azanium;bromide;hydrate
Create Date:
2019-10-03
20.
an image of a chemical structure CID 139196990

MW:
530.600
g/mol
MF:
C30H34N4O5
IUPAC name:
ethanol;N-(4-hydroxyphenyl)acetamide;4-[(E)-2-pyridin-4-ylet...
Create Date:
2019-10-03
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center