Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 254

1.
an image of a chemical structure CID 156390868

SCHEMBL23391006

MW:
377.800
g/mol
MF:
C19H17ClFNO4
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2021-08-21
2.
an image of a chemical structure CID 155408630

SCHEMBL22798943

MW:
829.300
g/mol
MF:
C48H45ClN2O9
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2021-01-30
3.
an image of a chemical structure CID 155147655

SCHEMBL22472310

MW:
403.800
g/mol
MF:
C19H16ClNNa2O4
Create Date:
2020-12-19
4.
an image of a chemical structure CID 154372870

ClC1=CC=C(C(=O)N2C(=C(C3=CC(=CC=C23)OC)CC(=O)O)C[Na])C=C1

MW:
379.800
g/mol
MF:
C19H15ClNNaO4
IUPAC name:
sodium;2-[1-(4-chlorobenzoyl)-2-methanidyl-5-methoxyindol-3-...
Create Date:
2020-08-14
5.
an image of a chemical structure CID 152957951

MW:
358.800
g/mol
MF:
C19H17ClNO4+
IUPAC name:
[4-[3-(carboxymethyl)-5-methoxy-2-methylindole-1-carbonyl]ph...
Create Date:
2020-08-13
6.
an image of a chemical structure CID 145927339

CH 137; Chinoin 137; beta-Cyclodextrin - indomethacin ...

MW:
2627.700
g/mol
MF:
C103H156ClNO74
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2020-02-27
7.
an image of a chemical structure CID 144736811

MW:
429.900
g/mol
MF:
C24H28ClNO4
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-12-07
8.
an image of a chemical structure CID 142838957

MW:
609.100
g/mol
MF:
C34H41ClN2O6
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-12-07
9.
an image of a chemical structure CID 142838956

MW:
505.000
g/mol
MF:
C27H37ClN2O5
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-12-07
10.
an image of a chemical structure CID 142077227

MW:
387.900
g/mol
MF:
C21H22ClNO4
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-12-06
11.
an image of a chemical structure CID 139205072

MW:
695.100
g/mol
MF:
C35H36ClFN4O8
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate;...
Create Date:
2019-10-03
13.
an image of a chemical structure CID 139145663

2-amino-5-picolinium Indomethacine 1:1

MW:
931.900
g/mol
MF:
C50H48Cl2N6O8
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate;...
Create Date:
2019-10-03
14.
an image of a chemical structure CID 139120178

alpha-indomethacin; 1-(4-chlorobenxoyl)-5-methoxy-2-methyl-1H-indole-3-acetic acid

MW:
1073.400
g/mol
MF:
C57H48Cl3N3O12
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-10-03
15.
an image of a chemical structure CID 139089396

Indomethacin Nicotinamide (1/1); 2-[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetic acid Pyridine-3-carboxamide (1/1)

MW:
479.900
g/mol
MF:
C25H22ClN3O5
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-10-03
16.
an image of a chemical structure CID 139066025

MW:
431.900
g/mol
MF:
C23H26ClNO5
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-10-03
17.
an image of a chemical structure CID 137528001

SCHEMBL20775250

MW:
1976.500
g/mol
MF:
C99H141Cl5N14O17
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-03-16
18.
an image of a chemical structure CID 137527845

SCHEMBL20775082

MW:
1381.900
g/mol
MF:
C69H93ClN4O23
IUPAC name:
4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxol...
Create Date:
2019-03-16
19.
an image of a chemical structure CID 137527140

SCHEMBL20774289

MW:
638.100
g/mol
MF:
C37H32ClNO7
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-03-16
20.
an image of a chemical structure CID 137525003

SCHEMBL20771841

MW:
1027.500
g/mol
MF:
C58H59ClN2O13
IUPAC name:
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic a...
Create Date:
2019-03-16
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center