Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 44

1.
an image of a chemical structure CID 129670597

water dibutylphthalate

MW:
296.360
g/mol
MF:
C16H24O5
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;hydrate
Create Date:
2017-09-13
2.
an image of a chemical structure CID 3026

dibutyl phthalate; 84-74-2; Di-n-butyl phthalate ...

MW:
278.340
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate
Create Date:
2005-03-25
3.
an image of a chemical structure CID 141479279

C(C1=C(C(=O)OCCCC)C(=CC=C1)[2H])(=O)OCCCC

MW:
279.350
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl 3-deuteriobenzene-1,2-dicarboxylate
Create Date:
2019-12-06
4.
an image of a chemical structure CID 102601147

DI-N-BUTYL PHTHALATE-D22; 358731-15-4; bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate ...

MW:
300.480
g/mol
MF:
C16H22O4
IUPAC name:
bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) 3,4,5,6-tetradeuter...
Create Date:
2016-01-08
5.
an image of a chemical structure CID 16213410

93952-11-5; Di-n-butyl phthalate-d4; Dibutyl phthalate-3,4,5,6-d4 ...

MW:
282.370
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
Create Date:
2007-07-12
6.
an image of a chemical structure CID 171810

66851-47-6; 1,2-Benzenedi(carboxylic-14C)acid, dibutyl ester; DTXSID20985461 ...

MW:
282.330
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate
Create Date:
2005-08-09
7.
an image of a chemical structure CID 156277076

SCHEMBL23248522

MW:
294.400
g/mol
MF:
C17H26O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;methane
Create Date:
2021-08-21
8.
an image of a chemical structure CID 129759742

water dibutyl phthalate water water

MW:
332.390
g/mol
MF:
C16H28O7
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;trihydrate
Create Date:
2017-09-13
9.
an image of a chemical structure CID 89407768

SCHEMBL14699542

MW:
382.500
g/mol
MF:
C24H30O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;styrene
Create Date:
2015-02-13
10.
an image of a chemical structure CID 88509497

SCHEMBL9747706

MW:
295.370
g/mol
MF:
C16H25NO4
IUPAC name:
azane;dibutyl benzene-1,2-dicarboxylate
Create Date:
2015-02-13
11.
an image of a chemical structure CID 88481116

SCHEMBL9562273

MW:
312.400
g/mol
MF:
C17H25FO4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;fluoromethane
Create Date:
2015-02-13
12.
an image of a chemical structure CID 70571663

SCHEMBL11361797

MW:
306.400
g/mol
MF:
C18H26O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;ethene
Create Date:
2012-12-01
13.
an image of a chemical structure CID 70554300

SCHEMBL11287116

MW:
336.500
g/mol
MF:
C20H32O4
IUPAC name:
butane;dibutyl benzene-1,2-dicarboxylate
Create Date:
2012-12-01
14.
an image of a chemical structure CID 70469897

SCHEMBL10908220

MW:
370.500
g/mol
MF:
C23H30O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;toluene
Create Date:
2012-12-01
15.
an image of a chemical structure CID 70445833

SCHEMBL10794635

MW:
350.400
g/mol
MF:
C19H26O6
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;prop-2-enoic acid
Create Date:
2012-12-01
16.
an image of a chemical structure CID 70372934

SCHEMBL10457930

MW:
397.700
g/mol
MF:
C17H23Cl3O4
IUPAC name:
chloroform;dibutyl benzene-1,2-dicarboxylate
Create Date:
2012-12-01
17.
an image of a chemical structure CID 70292726

SCHEMBL8167118

MW:
385.500
g/mol
MF:
C23H31NO4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;2,6-dimethylpyridine
Create Date:
2012-12-01
18.
an image of a chemical structure CID 70292416

SCHEMBL8165583

MW:
386.500
g/mol
MF:
C23H30O5
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;2-methylphenol
Create Date:
2012-12-01
19.
an image of a chemical structure CID 70291662

SCHEMBL8161965

MW:
364.400
g/mol
MF:
C20H28O6
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;2-methylprop-2-enoic acid
Create Date:
2012-12-01
20.
an image of a chemical structure CID 70287932

SCHEMBL8147054

MW:
376.340
g/mol
MF:
C16H25O8P
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;phosphoric acid
Create Date:
2012-12-01
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Support Center