Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 63

1.
an image of a chemical structure CID 131869277

n-(4-hydroxyphenyl-2,3,5,6-d4)acetamide-2,2,2-d3; 1219798-53-4; A935742

MW:
158.210
g/mol
MF:
C8H9NO2
IUPAC name:
2,2,2-trideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)a...
Create Date:
2017-12-18
2.
an image of a chemical structure CID 153907716

N([13C](=O)C)C1=CC=C(O)C=C1

MW:
152.150
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2020-08-14
3.
an image of a chemical structure CID 138396034

DTXSID50892679; N-[4-(~2~H)Hydroxyphenyl](N-~2~H)acetamide

MW:
153.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(4-deuteriooxyphenyl)acetamide
Create Date:
2019-06-20
4.
an image of a chemical structure CID 129853636

Paracetamol-d3

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
5.
an image of a chemical structure CID 129849378

N-Acetyl-4-aminophenol-d3

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,3,6-trideuterio-4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
6.
an image of a chemical structure CID 129735905

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N,2,2,2-tetradeuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
7.
an image of a chemical structure CID 76972945

[13C6]-Acetoaminophenol|||[13C6]-Paracetamol

MW:
157.120
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ace...
Create Date:
2014-08-25
8.
an image of a chemical structure CID 76972944

Acetaminophen-13C2, 15N1; [13C2,15N]-Acetaminophen; 360769-21-7

MW:
154.140
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2014-08-25
9.
an image of a chemical structure CID 56636999

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(2,3-dideuterio-4-hydroxyphenyl)acetamide
Create Date:
2012-02-26
10.
an image of a chemical structure CID 56632159

Acetaminophen-(ring-d4); Acetaminophen-D4 solution; SCHEMBL887976

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(2,3,6-trideuterio-4-hydroxyphenyl)acetamide
Create Date:
2012-02-26
11.
an image of a chemical structure CID 54294462

MW:
152.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2011-12-04
12.
an image of a chemical structure CID 45379481

DTXSID50670171; 4-ACETAMIDOPHENOL-RING-UL-14C; 90135-67-4 ...

MW:
163.120
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxy(1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl)ace...
Create Date:
2010-05-17
13.
an image of a chemical structure CID 12205927

Acetaminophen-d3; 60902-28-5; 2,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide ...

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
2,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2007-02-07
14.
an image of a chemical structure CID 12205925

Acetaminophen-d4; Paracetamol-d4; 64315-36-2 ...

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide
Create Date:
2007-02-07
15.
an image of a chemical structure CID 11506497

MW:
159.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxy-2,3,5,6-tetratritiophenyl)acetamide
Create Date:
2006-10-26
16.
an image of a chemical structure CID 11321051

MW:
152.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2-deuterio-4-hydroxyphenyl)acetamide
Create Date:
2006-10-26
17.
an image of a chemical structure CID 10986410

MW:
150.160
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2006-10-26
18.
an image of a chemical structure CID 10749384

MW:
153.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-(3,5-dideuterio-4-hydroxyphenyl)acetamide
Create Date:
2006-10-26
19.
an image of a chemical structure CID 10654423

MW:
153.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,6-dideuterio-4-hydroxyphenyl)acetamide
Create Date:
2006-10-25
20.
an image of a chemical structure CID 10464506

MW:
152.160
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2006-10-25
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Support Center