Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 27

1.
2.
an image of a chemical structure CID 154411636

[NH+]=1NC=CC=C2C=1C=CC=C2

MW:
145.180
g/mol
MF:
C9H9N2+
IUPAC name:
1H-1,2-benzodiazepin-2-ium
Create Date:
2020-08-14
3.
an image of a chemical structure CID 87667114

SCHEMBL4420872

MW:
252.040
g/mol
MF:
C9H8AgN2
IUPAC name:
1H-1,2-benzodiazepine;silver
Create Date:
2015-02-12
4.
an image of a chemical structure CID 87626723

SCHEMBL4144041

MW:
160.220
g/mol
MF:
C10H12N2
IUPAC name:
1H-1,2-benzodiazepine;methane
Create Date:
2015-02-12
5.
an image of a chemical structure CID 87524002

SCHEMBL3414245

MW:
230.090
g/mol
MF:
C9H9Cl2N3
Create Date:
2015-02-12
6.
an image of a chemical structure CID 71281622

SCHEMBL14740757

MW:
205.210
g/mol
MF:
C10H11N3O2
IUPAC name:
1H-1,2-benzodiazepine;carbamic acid
Create Date:
2013-03-21
7.
an image of a chemical structure CID 70621082

SCHEMBL11613911

MW:
180.630
g/mol
MF:
C9H9ClN2
IUPAC name:
1H-1,2-benzodiazepin-1-ium;chloride
Create Date:
2012-12-01
8.
an image of a chemical structure CID 70285825

SCHEMBL8139617

MW:
162.190
g/mol
MF:
C9H10N2O
IUPAC name:
1H-1,2-benzodiazepine;hydrate
Create Date:
2012-12-01
9.
an image of a chemical structure CID 70281944

SCHEMBL8126473

MW:
180.200
g/mol
MF:
C9H12N2O2
IUPAC name:
1H-1,2-benzodiazepine;dihydrate
Create Date:
2012-12-01
10.
an image of a chemical structure CID 70281340

SCHEMBL8124489

MW:
198.650
g/mol
MF:
C9H11ClN2O
IUPAC name:
1H-1,2-benzodiazepine;hydrate;hydrochloride
Create Date:
2012-12-01
11.
an image of a chemical structure CID 70008027

SCHEMBL7160172

MW:
288.300
g/mol
MF:
C18H16N4
IUPAC name:
1H-1,2-benzodiazepine
Create Date:
2012-12-01
12.
an image of a chemical structure CID 69262915

SCHEMBL4971764

MW:
202.250
g/mol
MF:
C12H14N2O
IUPAC name:
1H-1,2-benzodiazepine;propan-2-one
Create Date:
2012-12-01
13.
an image of a chemical structure CID 69150473

MW:
271.140
g/mol
MF:
C9H16Cl2N2O3
IUPAC name:
1H-1,2-benzodiazepine;trihydrate;dihydrochloride
Create Date:
2012-11-30
14.
an image of a chemical structure CID 67869421

SCHEMBL9528199

MW:
306.400
g/mol
MF:
C18H18N4O
IUPAC name:
1H-1,2-benzodiazepine;hydrate
Create Date:
2012-11-30
15.
an image of a chemical structure CID 66868622

SCHEMBL988773

MW:
184.250
g/mol
MF:
C9H8CaN2
Create Date:
2012-11-30
16.
an image of a chemical structure CID 23170901

SCHEMBL10694670

MW:
206.200
g/mol
MF:
C10H10N2O3
IUPAC name:
1H-1,2-benzodiazepine;carbonic acid
Create Date:
2007-12-05
17.
an image of a chemical structure CID 22414443

SCHEMBL936208

MW:
180.630
g/mol
MF:
C9H9ClN2
IUPAC name:
1H-1,2-benzodiazepine;hydrochloride
Create Date:
2007-12-05
18.
an image of a chemical structure CID 21982918

SCHEMBL1505200; SCHEMBL6618830

MW:
161.200
g/mol
MF:
C9H11N3
IUPAC name:
azane;1H-1,2-benzodiazepine
Create Date:
2007-12-05
19.
an image of a chemical structure CID 21947021

SCHEMBL5546792

MW:
351.000
g/mol
MF:
C9H8N2Pb
Create Date:
2007-12-05
20.
an image of a chemical structure CID 21842330

SCHEMBL1574261

MW:
204.230
g/mol
MF:
C10H12N4O
IUPAC name:
1H-1,2-benzodiazepine;urea
Create Date:
2007-12-05
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center