Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 44

1.
an image of a chemical structure CID 171810

66851-47-6; 1,2-Benzenedi(carboxylic-14C)acid, dibutyl ester; DTXSID20985461 ...

MW:
282.330
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate
Create Date:
2005-08-09
2.
an image of a chemical structure CID 141479279

C(C1=C(C(=O)OCCCC)C(=CC=C1)[2H])(=O)OCCCC

MW:
279.350
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl 3-deuteriobenzene-1,2-dicarboxylate
Create Date:
2019-12-06
3.
an image of a chemical structure CID 102601147

DI-N-BUTYL PHTHALATE-D22; 358731-15-4; bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate ...

MW:
300.480
g/mol
MF:
C16H22O4
IUPAC name:
bis(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl) 3,4,5,6-tetradeuter...
Create Date:
2016-01-08
4.
an image of a chemical structure CID 16213410

93952-11-5; Di-n-butyl phthalate-d4; Dibutyl phthalate-3,4,5,6-d4 ...

MW:
282.370
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
Create Date:
2007-07-12
5.
an image of a chemical structure CID 3026

dibutyl phthalate; 84-74-2; Di-n-butyl phthalate ...

MW:
278.340
g/mol
MF:
C16H22O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate
Create Date:
2005-03-25
6.
an image of a chemical structure CID 156277076

SCHEMBL23248522

MW:
294.400
g/mol
MF:
C17H26O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;methane
Create Date:
2021-08-21
7.
an image of a chemical structure CID 129759742

water dibutyl phthalate water water

MW:
332.390
g/mol
MF:
C16H28O7
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;trihydrate
Create Date:
2017-09-13
8.
an image of a chemical structure CID 129670597

water dibutylphthalate

MW:
296.360
g/mol
MF:
C16H24O5
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;hydrate
Create Date:
2017-09-13
9.
an image of a chemical structure CID 89407768

SCHEMBL14699542

MW:
382.500
g/mol
MF:
C24H30O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;styrene
Create Date:
2015-02-13
10.
an image of a chemical structure CID 88509497

SCHEMBL9747706

MW:
295.370
g/mol
MF:
C16H25NO4
IUPAC name:
azane;dibutyl benzene-1,2-dicarboxylate
Create Date:
2015-02-13
11.
an image of a chemical structure CID 88481116

SCHEMBL9562273

MW:
312.400
g/mol
MF:
C17H25FO4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;fluoromethane
Create Date:
2015-02-13
12.
an image of a chemical structure CID 70571663

SCHEMBL11361797

MW:
306.400
g/mol
MF:
C18H26O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;ethene
Create Date:
2012-12-01
13.
an image of a chemical structure CID 70554300

SCHEMBL11287116

MW:
336.500
g/mol
MF:
C20H32O4
IUPAC name:
butane;dibutyl benzene-1,2-dicarboxylate
Create Date:
2012-12-01
14.
an image of a chemical structure CID 70469897

SCHEMBL10908220

MW:
370.500
g/mol
MF:
C23H30O4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;toluene
Create Date:
2012-12-01
15.
an image of a chemical structure CID 70445833

SCHEMBL10794635

MW:
350.400
g/mol
MF:
C19H26O6
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;prop-2-enoic acid
Create Date:
2012-12-01
16.
an image of a chemical structure CID 70372934

SCHEMBL10457930

MW:
397.700
g/mol
MF:
C17H23Cl3O4
IUPAC name:
chloroform;dibutyl benzene-1,2-dicarboxylate
Create Date:
2012-12-01
17.
an image of a chemical structure CID 70292726

SCHEMBL8167118

MW:
385.500
g/mol
MF:
C23H31NO4
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;2,6-dimethylpyridine
Create Date:
2012-12-01
18.
an image of a chemical structure CID 70292416

SCHEMBL8165583

MW:
386.500
g/mol
MF:
C23H30O5
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;2-methylphenol
Create Date:
2012-12-01
19.
an image of a chemical structure CID 70291662

SCHEMBL8161965

MW:
364.400
g/mol
MF:
C20H28O6
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;2-methylprop-2-enoic acid
Create Date:
2012-12-01
20.
an image of a chemical structure CID 70287932

SCHEMBL8147054

MW:
376.340
g/mol
MF:
C16H25O8P
IUPAC name:
dibutyl benzene-1,2-dicarboxylate;phosphoric acid
Create Date:
2012-12-01
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center