Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 63

1.
an image of a chemical structure CID 1983

acetaminophen; Paracetamol; 4-Acetamidophenol ...

MW:
151.160
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2004-09-16
2.
an image of a chemical structure CID 153907716

N([13C](=O)C)C1=CC=C(O)C=C1

MW:
152.150
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2020-08-14
3.
an image of a chemical structure CID 138396034

DTXSID50892679; N-[4-(~2~H)Hydroxyphenyl](N-~2~H)acetamide

MW:
153.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(4-deuteriooxyphenyl)acetamide
Create Date:
2019-06-20
4.
an image of a chemical structure CID 131869277

MW:
158.210
g/mol
MF:
C8H9NO2
IUPAC name:
2,2,2-trideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)a...
Create Date:
2017-12-18
5.
an image of a chemical structure CID 129853636

Paracetamol-d3

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
6.
an image of a chemical structure CID 129849378

N-Acetyl-4-aminophenol-d3

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,3,6-trideuterio-4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
7.
an image of a chemical structure CID 129735905

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N,2,2,2-tetradeuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2017-09-13
8.
an image of a chemical structure CID 76972945

[13C6]-Acetoaminophenol|||[13C6]-Paracetamol

MW:
157.120
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ace...
Create Date:
2014-08-25
9.
an image of a chemical structure CID 76972944

[13C2,15N]-Acetaminophen; 360769-21-7; Acetaminophen-13C2, 15N1

MW:
154.140
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2014-08-25
10.
an image of a chemical structure CID 56636999

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(2,3-dideuterio-4-hydroxyphenyl)acetamide
Create Date:
2012-02-26
11.
an image of a chemical structure CID 56632159

Acetaminophen-(ring-d4); Acetaminophen-D4 solution; SCHEMBL887976

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(2,3,6-trideuterio-4-hydroxyphenyl)acetamide
Create Date:
2012-02-26
12.
an image of a chemical structure CID 54294462

MW:
152.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-deuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2011-12-04
13.
an image of a chemical structure CID 45379481

DTXSID50670171; 4-ACETAMIDOPHENOL-RING-UL-14C; 90135-67-4 ...

MW:
163.120
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxy(1,2,3,4,5,6-14C6)cyclohexa-1,3,5-trien-1-yl)ace...
Create Date:
2010-05-17
14.
an image of a chemical structure CID 12205927

Acetaminophen-d3; 60902-28-5; 2,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide ...

MW:
154.180
g/mol
MF:
C8H9NO2
IUPAC name:
2,2,2-trideuterio-N-(4-hydroxyphenyl)acetamide
Create Date:
2007-02-07
15.
an image of a chemical structure CID 12205925

Acetaminophen-d4; Paracetamol-d4; 64315-36-2 ...

MW:
155.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide
Create Date:
2007-02-07
16.
an image of a chemical structure CID 11506497

MW:
159.190
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxy-2,3,5,6-tetratritiophenyl)acetamide
Create Date:
2006-10-26
17.
an image of a chemical structure CID 11321051

MW:
152.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2-deuterio-4-hydroxyphenyl)acetamide
Create Date:
2006-10-26
18.
an image of a chemical structure CID 10986410

MW:
150.160
g/mol
MF:
C8H9NO2
IUPAC name:
N-(4-hydroxyphenyl)acetamide
Create Date:
2006-10-26
19.
an image of a chemical structure CID 10749384

MW:
153.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-(3,5-dideuterio-4-hydroxyphenyl)acetamide
Create Date:
2006-10-26
20.
an image of a chemical structure CID 10654423

MW:
153.170
g/mol
MF:
C8H9NO2
IUPAC name:
N-(2,6-dideuterio-4-hydroxyphenyl)acetamide
Create Date:
2006-10-25
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center