Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 506

1.
an image of a chemical structure CID 5460926

(2S)-2,6-diammoniohexanoate; L-lysine monocation; L-lysinium ...

MW:
147.200
g/mol
MF:
C6H15N2O2+
IUPAC name:
(2S)-2,6-bis(azaniumyl)hexanoate
Create Date:
2004-09-16
2.
an image of a chemical structure CID 5962

L-lysine; lysine; 56-87-1 ...

MW:
146.190
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-2,6-diaminohexanoic acid
Create Date:
2004-09-16
3.
an image of a chemical structure CID 155640846

MW:
147.190
g/mol
MF:
C6H14N2O2
IUPAC name:
2,6-diamino-2-deuteriohexanoic acid
Create Date:
2021-02-21
4.
an image of a chemical structure CID 153711326

N([C@](C(CCCN)[2H])(C(=O)O)[2H])([2H])[2H]

MW:
150.210
g/mol
MF:
C6H14N2O2
IUPAC name:
(2R)-6-amino-2,3-dideuterio-2-(dideuterioamino)hexanoic acid
Create Date:
2020-08-14
5.
an image of a chemical structure CID 153694890

MW:
150.141
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-6-(14N)azanyl-2,3-dideuterio-2-(dideuterio(14N)amino)(1...
Create Date:
2020-08-14
6.
an image of a chemical structure CID 153694824

N([C@](C(C(C(CN)[2H])([2H])[2H])([2H])[2H])(C(=O)O)[2H])([2H])[2H]

MW:
154.240
g/mol
MF:
C6H14N2O2
IUPAC name:
(2R)-6-amino-2,3,3,4,4,5-hexadeuterio-2-(dideuterioamino)hex...
Create Date:
2020-08-14
7.
an image of a chemical structure CID 153693994

MW:
146.180
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-2,6-diamino(212C)hexanoic acid
Create Date:
2020-08-14
8.
an image of a chemical structure CID 150791321

MW:
151.150
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-2,6-diamino(2,3,4,5,6-13C5)hexanoic acid
Create Date:
2020-08-13
9.
an image of a chemical structure CID 148178435

MW:
158.161
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S,3S,6S)-2,6-bis(15N)(azanyl)-3,4,4,5,5,6-hexadeuterio(4,5...
Create Date:
2020-08-12
10.
an image of a chemical structure CID 141740771

MW:
155.240
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-6-amino-2,3,3,4,4,5,5-heptadeuterio-2-(dideuterioamino)...
Create Date:
2019-12-06
11.
an image of a chemical structure CID 141241661

MW:
151.220
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-6-amino-2,3,3-trideuterio-2-(dideuterioamino)hexanoic a...
Create Date:
2019-12-06
12.
an image of a chemical structure CID 140533859

MW:
158.180
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S,3R,6R)-2,6-bis(15N)(azanyl)-3,4,4,5,5,6-hexadeuterio(1,2...
Create Date:
2019-12-06
13.
an image of a chemical structure CID 135739675

D-Lysine-13C6; 1182252-66-9

MW:
152.140
g/mol
MF:
C6H14N2O2
IUPAC name:
(2R)-2,6-diamino(1,2,3,4,5,6-13C6)hexanoic acid
Create Date:
2019-01-17
14.
an image of a chemical structure CID 135207569

SCHEMBL20362357

MW:
148.170
g/mol
MF:
C6H14N2O2
IUPAC name:
2,6-diamino(2,6-13C2)hexanoic acid
Create Date:
2018-12-15
15.
an image of a chemical structure CID 134261062

MW:
147.190
g/mol
MF:
C6H14N2O2
IUPAC name:
deuterio 2,6-diaminohexanoate
Create Date:
2018-06-23
16.
an image of a chemical structure CID 131854682

MW:
148.180
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-2,6-diamino(214C)hexanoic acid
Create Date:
2017-12-18
17.
an image of a chemical structure CID 131852320

MW:
148.170
g/mol
MF:
C6H14N2O2
IUPAC name:
6-amino-2-(15N)azanyl(613C)hexanoic acid
Create Date:
2017-12-18
18.
an image of a chemical structure CID 131708709

MW:
153.140
g/mol
MF:
C6H14N2O2
IUPAC name:
(2S)-2-amino-6-(15N)azanyl(1,2,3,4,5,6-13C6)hexanoic acid
Create Date:
2017-11-01
19.
an image of a chemical structure CID 131708625

MW:
154.240
g/mol
MF:
C6H14N2O2
IUPAC name:
(2R)-2,6-diamino-3,3,4,4,5,5,6,6-octadeuteriohexanoic acid
Create Date:
2017-11-01
20.
an image of a chemical structure CID 131708617

MW:
150.210
g/mol
MF:
C6H14N2O2
IUPAC name:
(2R)-2,6-diamino-4,4,5,5-tetradeuteriohexanoic acid
Create Date:
2017-11-01
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Support Center