Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 1102

1.
2.
3.
an image of a chemical structure CID 59107275

MW:
68.110
g/mol
MF:
C5H6
IUPAC name:
5-tritiocyclopenta-1,3-diene
Create Date:
2012-08-20
4.
an image of a chemical structure CID 23385811

deuterocyclopentadiene

MW:
67.110
g/mol
MF:
C5H6
IUPAC name:
1-deuteriocyclopenta-1,3-diene
Create Date:
2007-12-06
5.
an image of a chemical structure CID 12736572

monodeuterocyclopentadiene

MW:
67.110
g/mol
MF:
C5H6
IUPAC name:
5-deuteriocyclopenta-1,3-diene
Create Date:
2007-02-08
6.
an image of a chemical structure CID 12524604

2-deuterocyclopentadiene

MW:
67.110
g/mol
MF:
C5H6
IUPAC name:
2-deuteriocyclopenta-1,3-diene
Create Date:
2007-02-08
7.
an image of a chemical structure CID 12456259

MW:
71.130
g/mol
MF:
C5H6
IUPAC name:
1,2,3,4,5-pentadeuteriocyclopenta-1,3-diene
Create Date:
2007-02-08
8.
an image of a chemical structure CID 12201260

1,2,3,4,5,5-hexadeuteriocyclopenta-1,3-diene

MW:
72.140
g/mol
MF:
C5H6
IUPAC name:
1,2,3,4,5,5-hexadeuteriocyclopenta-1,3-diene
Create Date:
2007-02-07
9.
an image of a chemical structure CID 155634150

MW:
315.500
g/mol
MF:
C9H17Os
IUPAC name:
carbanide;cyclopenta-1,3-diene;osmium(5+)
Create Date:
2021-02-21
10.
an image of a chemical structure CID 155295048

cyclopenta-dienyl erbium

MW:
232.350
g/mol
MF:
C5H5Er-
IUPAC name:
cyclopenta-1,3-diene;erbium
Create Date:
2021-01-15
11.
an image of a chemical structure CID 154926083

zirconocene hydride

MW:
222.420
g/mol
MF:
C10H11Zr
IUPAC name:
cyclopenta-1,3-diene;hydride;zirconium(3+)
Create Date:
2020-12-18
12.
an image of a chemical structure CID 154825015

37342-97-5; 3,4-DIETHOXYBENZOICACIDETHYLESTER

MW:
256.860
g/mol
MF:
C10H10ClZr+
IUPAC name:
cyclopenta-1,3-diene;zirconium(4+);chloride
Create Date:
2020-12-08
13.
an image of a chemical structure CID 154512275

C[Mo](C1C=CC=C1)(C)(C)(C)(C)(C)C

MW:
266.280
g/mol
MF:
C12H26Mo-8
IUPAC name:
carbanide;cyclopenta-1,3-diene;molybdenum
Create Date:
2020-08-14
14.
an image of a chemical structure CID 154500189

[SiH2]=[Zr](C1C=CC=C1)C1C=CC=C1

MW:
251.510
g/mol
MF:
C10H12SiZr
IUPAC name:
cyclopenta-1,3-diene;silylidenezirconium(2+)
Create Date:
2020-08-14
15.
an image of a chemical structure CID 154484157

[SiH2]=[Ti](C1C=CC=C1)C1C=CC=C1

MW:
208.150
g/mol
MF:
C10H12SiTi
IUPAC name:
cyclopenta-1,3-diene;silylidenetitanium(2+)
Create Date:
2020-08-14
16.
an image of a chemical structure CID 154480592

C[V](C)C1C=CC=C1

MW:
146.100
g/mol
MF:
C7H11V-3
IUPAC name:
carbanide;cyclopenta-1,3-diene;vanadium
Create Date:
2020-08-14
17.
an image of a chemical structure CID 154454478

C[Zr](C1C=CC=C1)C1=CC=CC1

MW:
236.440
g/mol
MF:
C11H13Zr
IUPAC name:
carbanide;cyclopenta-1,3-diene;cyclopenta-1,3-diene;zirconiu...
Create Date:
2020-08-14
18.
an image of a chemical structure CID 154445516

C[Ti](C1C=CC=C1)C1C=CC=C1

MW:
193.090
g/mol
MF:
C11H13Ti
IUPAC name:
carbanide;cyclopenta-1,3-diene;titanium(3+)
Create Date:
2020-08-14
19.
an image of a chemical structure CID 154440233

C1(C=CC=C1)[Os+]

MW:
255.300
g/mol
MF:
C5H5Os+
IUPAC name:
cyclopenta-1,3-diene;osmium(2+)
Create Date:
2020-08-14
20.
an image of a chemical structure CID 154439021

C1(C=CC=C1)[Hf+3]

MW:
243.580
g/mol
MF:
C5H5Hf+3
IUPAC name:
cyclopenta-1,3-diene;hafnium(4+)
Create Date:
2020-08-14
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Support Center