Format
Items per page
Sort by

Send to:

Choose Destination

Links from PubChem Compound

Items: 1 to 20 of 27

1.
2.
an image of a chemical structure CID 153695530

C=1(C=C(C=2C=CC3=C(C4=C(C=5C=CC=1C=2C=53)C=CC=C4)[3H])[3H])[3H]

MW:
258.300
g/mol
MF:
C20H12
IUPAC name:
1,3,6-tritritiobenzo[a]pyrene
Create Date:
2020-08-14
3.
an image of a chemical structure CID 153693924

[14CH]1=CC=C2C=CC=3C=C4C(=C5C=CC1=C2C5=3)C=CC=C4

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
benzo[a]pyrene
Create Date:
2020-08-14
4.
an image of a chemical structure CID 141214974

MW:
253.300
g/mol
MF:
C20H12
IUPAC name:
1-deuteriobenzo[a]pyrene
Create Date:
2019-12-06
5.
an image of a chemical structure CID 129850106

benzo[a]pyrene-d10

MW:
262.400
g/mol
MF:
C20H12
IUPAC name:
1,2,3,4,5,6,7,8,9,10-decadeuteriobenzo[a]pyrene
Create Date:
2017-09-13
6.
an image of a chemical structure CID 102289369

MW:
256.280
g/mol
MF:
C20H12
IUPAC name:
benzo[a]pyrene
Create Date:
2015-12-25
7.
an image of a chemical structure CID 101864605

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
benzo[a]pyrene
Create Date:
2015-12-18
8.
an image of a chemical structure CID 66552883

MW:
256.280
g/mol
MF:
C20H12
IUPAC name:
benzo[a]pyrene
Create Date:
2012-10-30
9.
an image of a chemical structure CID 15590256

Benzo[a]pyrene-7-14C; Benzo(a)pyrene-7-14C; AKOS015916723

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
benzo[a]pyrene
Create Date:
2007-02-12
10.
an image of a chemical structure CID 12202235

Benzo[a]pyrene-d12; 63466-71-7; Benzo[a]pyrene D12 ...

MW:
264.400
g/mol
MF:
C20H12
IUPAC name:
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]pyrene
Create Date:
2007-02-07
11.
an image of a chemical structure CID 6911868

Benzo[a]pyrene-7,8-d2; 7,8-dideuteriobenzo[a]pyrene; 206752-38-7 ...

MW:
254.300
g/mol
MF:
C20H12
IUPAC name:
7,8-dideuteriobenzo[a]pyrene
Create Date:
2006-07-04
12.
an image of a chemical structure CID 6911867

Benzo[a]pyrene-8-d; 8-deuteriobenzo[a]pyrene; 206752-39-8 ...

MW:
253.300
g/mol
MF:
C20H12
IUPAC name:
8-deuteriobenzo[a]pyrene
Create Date:
2006-07-04
13.
an image of a chemical structure CID 6911866

Benzo[a]pyrene-7-d; 7-deuteriobenzo[a]pyrene; 68041-22-5 ...

MW:
253.300
g/mol
MF:
C20H12
IUPAC name:
7-deuteriobenzo[a]pyrene
Create Date:
2006-07-04
14.
an image of a chemical structure CID 156614102
new record, indexing in progress
CID:
156614102
15.
an image of a chemical structure CID 155887664

MW:
528.800
g/mol
MF:
C40H24
IUPAC name:
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]pyrene
Create Date:
2021-04-22
16.
an image of a chemical structure CID 144462842

MW:
312.400
g/mol
MF:
C24H24
IUPAC name:
benzo[a]pyrene;ethane
Create Date:
2019-12-07
17.
an image of a chemical structure CID 141367771

MW:
504.600
g/mol
MF:
C40H24
IUPAC name:
benzo[a]pyrene
Create Date:
2019-12-06
18.
an image of a chemical structure CID 129719405

benzo(a)pyrene water

MW:
270.300
g/mol
MF:
C20H14O
IUPAC name:
benzo[a]pyrene;hydrate
Create Date:
2017-09-13
19.
an image of a chemical structure CID 91195193

MW:
338.400
g/mol
MF:
C25H22O
IUPAC name:
benzo[a]pyrene;pentan-2-one
Create Date:
2015-03-17
20.
an image of a chemical structure CID 91164935

MW:
324.500
g/mol
MF:
C25H24
IUPAC name:
benzo[a]pyrene;2,2-dimethylpropane
Create Date:
2015-03-17
Format
Items per page
Sort by

Send to:

Choose Destination

Supplemental Content

Refine your results

Subsets of your results

Find related data

Recent activity

Your browsing activity is empty.

Activity recording is turned off.

Turn recording back on

See more...
Support Center